EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H8O3 |
| Net Charge | 0 |
| Average Mass | 116.116 |
| Monoisotopic Mass | 116.04734 |
| SMILES | [H]C(=O)CCCC(=O)O |
| InChI | InChI=1S/C5H8O3/c6-4-2-1-3-5(7)8/h4H,1-3H2,(H,7,8) |
| InChIKey | VBKPPDYGFUZOAJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-oxopentanoic acid (CHEBI:39153) is a aldehydic acid (CHEBI:26643) |
| 5-oxopentanoic acid (CHEBI:39153) is a oxopentanoic acid (CHEBI:25799) |
| 5-oxopentanoic acid (CHEBI:39153) is a ω-oxo fatty acid (CHEBI:76328) |
| 5-oxopentanoic acid (CHEBI:39153) is conjugate acid of 5-oxopentanoate (CHEBI:16120) |
| Incoming Relation(s) |
| 1-O-hexadecyl-2-(5-oxovaleroyl)-sn-glycero-3-phosphocholine (CHEBI:142764) has functional parent 5-oxopentanoic acid (CHEBI:39153) |
| 5-oxopentanoate (CHEBI:16120) is conjugate base of 5-oxopentanoic acid (CHEBI:39153) |
| IUPAC Name |
|---|
| 5-oxopentanoic acid |
| Synonyms | Source |
|---|---|
| 2-formylethylacetic acid | ChEBI |
| 4-formylbutyric acid | ChemIDplus |
| 5-Oxopentanoate | KEGG COMPOUND |
| 5-Oxo-valeriansäure | ChEBI |
| 5-oxo-valeric acid | ChEBI |
| 5-oxovaleric acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C03273 | KEGG COMPOUND |
| LMFA01060161 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1747012 | Beilstein |
| Reaxys:1747012 | Reaxys |
| CAS:5746-02-1 | ChemIDplus |