EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C51H63FeN6O9 |
| Net Charge | 0 |
| Average Mass | 959.943 |
| Monoisotopic Mass | 959.40059 |
| SMILES | CC(/C=C/C(=O)N[O][Fe]([O]NC(=O)/C=C/C(C)=C/[C@@H](C)C(=O)c1ccc(N(C)C)cc1)[O]NC(=O)/C=C/C(C)=C/[C@@H](C)C(=O)c1ccc(N(C)C)cc1)=C\[C@@H](C)C(=O)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/3C17H21N2O3.Fe/c3*1-12(5-10-16(20)18-22)11-13(2)17(21)14-6-8-15(9-7-14)19(3)4;/h3*5-11,13H,1-4H3,(H-,18,20,22);/q3*-1;+3/b3*10-5+,12-11+;/t3*13-;/m111./s1 |
| InChIKey | WTWHYHPOGZUENL-KZKGWZQBSA-N |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trichostatin B (CHEBI:39148) is a iron coordination entity (CHEBI:33892) |
| trichostatin B (CHEBI:39148) is a trichostatin (CHEBI:39146) |
| IUPAC Name |
|---|
| tris[(2E,4E,6R)-7-[4-(dimethylamino)phenyl]-N-(hydroxy-κO)-4,6-dimethyl-7-oxohepta-2,4-dienamidato-κO]iron |