EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H26O3 |
| Net Charge | 0 |
| Average Mass | 302.414 |
| Monoisotopic Mass | 302.18819 |
| SMILES | C=CCC1=C(C)[C@H](OC(=O)[C@@H]2[C@H](C=C(C)C)C2(C)C)CC1=O |
| InChI | InChI=1S/C19H26O3/c1-7-8-13-12(4)16(10-15(13)20)22-18(21)17-14(9-11(2)3)19(17,5)6/h7,9,14,16-17H,1,8,10H2,2-6H3/t14-,16+,17-/m0/s1 |
| InChIKey | ZCVAOQKBXKSDMS-UAGQMJEPSA-N |
| Roles Classification |
|---|
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-cis-(R)-allethrin (CHEBI:39137) is a (+)-cis-allethrin (CHEBI:39135) |
| (+)-cis-(R)-allethrin (CHEBI:39137) is enantiomer of (−)-cis-(S)-allethrin (CHEBI:39139) |
| Incoming Relation(s) |
| (−)-cis-(S)-allethrin (CHEBI:39139) is enantiomer of (+)-cis-(R)-allethrin (CHEBI:39137) |
| IUPAC Name |
|---|
| (1R)-2-methyl-4-oxo-3-(prop-2-en-1-yl)cyclopent-2-en-1-yl (1R,3S)-2,2-dimethyl-3-(2-methylprop-1-en-1-yl)cyclopropanecarboxylate |
| Synonym | Source |
|---|---|
| (1R)-3-allyl-2-methyl-4-oxocyclopent-2-en-1-yl (1R,3S)-2,2-dimethyl-3-(2-methylprop-1-en-1-yl)cyclopropanecarboxylate | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3214669 | Beilstein |