EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H26O3 |
| Net Charge | 0 |
| Average Mass | 302.414 |
| Monoisotopic Mass | 302.18819 |
| SMILES | C=CCC1=C(C)[C@@H](OC(=O)[C@@H]2[C@@H](C=C(C)C)C2(C)C)CC1=O |
| InChI | InChI=1S/C19H26O3/c1-7-8-13-12(4)16(10-15(13)20)22-18(21)17-14(9-11(2)3)19(17,5)6/h7,9,14,16-17H,1,8,10H2,2-6H3/t14-,16+,17+/m1/s1 |
| InChIKey | ZCVAOQKBXKSDMS-PVAVHDDUSA-N |
| Roles Classification |
|---|
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-trans-(S)-allethrin (CHEBI:39115) is a (+)-trans-allethrin (CHEBI:39118) |
| (+)-trans-(S)-allethrin (CHEBI:39115) is enantiomer of (−)-trans-(R)-allethrin (CHEBI:39121) |
| Incoming Relation(s) |
| (−)-trans-(R)-allethrin (CHEBI:39121) is enantiomer of (+)-trans-(S)-allethrin (CHEBI:39115) |
| IUPAC Name |
|---|
| (1S)-2-methyl-4-oxo-3-(prop-2-en-1-yl)cyclopent-2-en-1-yl (1R,3R)-2,2-dimethyl-3-(2-methylprop-1-en-1-yl)cyclopropanecarboxylate |
| Synonyms | Source |
|---|---|
| (S)-3-allyl-3-methyl-4-oxocyclopent-2-enyl (+)-trans-chrysanthemate | ChemIDplus |
| (1S)-3-allyl-2-methyl-4-oxocyclopent-2-en-1-yl (1R,3R)-2,2-dimethyl-3-(2-methylprop-1-en-1-yl)cyclopropanecarboxylate | IUPAC |
| trans-(+)-allethrin | ChemIDplus |
| S-bioallethrin | ChemIDplus |
| bioallethrin S-cyclopentenyl | ChEBI |
| bioallethrin S-cyclopentenyl isomer | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 4354 | DrugCentral |
| LMPR0102060006 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2059862 | Beilstein |
| CAS:28434-00-6 | ChemIDplus |