EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16O2 |
| Net Charge | 0 |
| Average Mass | 168.236 |
| Monoisotopic Mass | 168.11503 |
| SMILES | CC(C)=C[C@H]1[C@H](C(=O)O)C1(C)C |
| InChI | InChI=1S/C10H16O2/c1-6(2)5-7-8(9(11)12)10(7,3)4/h5,7-8H,1-4H3,(H,11,12)/t7-,8+/m0/s1 |
| InChIKey | XLOPRKKSAJMMEW-JGVFFNPUSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-trans-chrysanthemic acid (CHEBI:39102) is a trans-chrysanthemic acid (CHEBI:39101) |
| (−)-trans-chrysanthemic acid (CHEBI:39102) is enantiomer of (+)-trans-chrysanthemic acid (CHEBI:39100) |
| Incoming Relation(s) |
| (−)-trans-allethrin (CHEBI:39120) has functional parent (−)-trans-chrysanthemic acid (CHEBI:39102) |
| (+)-trans-chrysanthemic acid (CHEBI:39100) is enantiomer of (−)-trans-chrysanthemic acid (CHEBI:39102) |
| IUPAC Name |
|---|
| (1S,3S)-2,2-dimethyl-3-(2-methylprop-1-en-1-yl)cyclopropanecarboxylic acid |
| Synonyms | Source |
|---|---|
| (1S-trans)-2,2-dimethyl-3-(2-methyl-1-propenyl)cyclopropanecarboxylic acid | ChemIDplus |
| (1S-trans)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarboxylic acid | ChemIDplus |
| l-trans-chrysanthemic acid | ChemIDplus |
| (−)-trans-chrysanthemic acid | ChemIDplus |
| (−)-trans-Chrysanthemumsäure | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1862973 | Beilstein |
| Beilstein:4904352 | Beilstein |
| CAS:2259-14-5 | ChemIDplus |