EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H6Br2N2O9.2Na |
| Net Charge | 0 |
| Average Mass | 624.061 |
| Monoisotopic Mass | 621.82354 |
| SMILES | O=C1OC2(c3ccccc31)c1cc([N+](=O)[O-])c([O-])c(Br)c1Oc1c2cc([N+](=O)[O-])c([O-])c1Br.[Na+].[Na+] |
| InChI | InChI=1S/C20H8Br2N2O9.2Na/c21-13-15(25)11(23(28)29)5-9-17(13)32-18-10(6-12(24(30)31)16(26)14(18)22)20(9)8-4-2-1-3-7(8)19(27)33-20;;/h1-6,25-26H;;/q;2*+1/p-2 |
| InChIKey | QGAYMQGSQUXCQO-UHFFFAOYSA-L |
| Roles Classification |
|---|
| Applications: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| eosin b (CHEBI:39077) has part eosin b(2−) (CHEBI:68617) |
| eosin b (CHEBI:39077) has role fluorescent dye (CHEBI:51121) |
| eosin b (CHEBI:39077) has role histological dye (CHEBI:77178) |
| eosin b (CHEBI:39077) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| disodium 4',5'-dibromo-2',7'-dinitro-3-oxo-3H-spiro[2-benzofuran-1,9'-xanthene]-3',6'-diolate |
| Synonyms | Source |
|---|---|
| 2-(4,5-Dibromo-3,6-dihydroxy-2,7-dinitroxanthen-9-yl)-benzoic acid, disodium salt | ChemIDplus |
| acid red 91 | ChEBI |
| C.I. 45400 | ChEBI |
| C.I. Acid Red 91 | ChemIDplus |
| Dibromodinitrofluorescein sodium | ChemIDplus |
| eosin bluish | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:548-24-3 | ChemIDplus |