EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H16FN5 |
| Net Charge | 0 |
| Average Mass | 309.348 |
| Monoisotopic Mass | 309.13897 |
| SMILES | NCc1ccc(Nc2ncc(F)c(Nc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C17H16FN5/c18-15-11-20-17(22-14-8-6-12(10-19)7-9-14)23-16(15)21-13-4-2-1-3-5-13/h1-9,11H,10,19H2,(H2,20,21,22,23) |
| InChIKey | UKOHFWNBTUJMMN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | protein kinase inhibitor An EC 2.7.* (P-containing group transferase) inhibitor that interferes with the action of protein kinases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| CZC8004 (CHEBI:39072) has role protein kinase inhibitor (CHEBI:37699) |
| CZC8004 (CHEBI:39072) is a aminopyrimidine (CHEBI:38338) |
| CZC8004 (CHEBI:39072) is a organofluorine compound (CHEBI:37143) |
| IUPAC Name |
|---|
| N2-[4-(aminomethyl)phenyl]-5-fluoro-N4-phenylpyrimidine-2,4-diamine |