EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C55H59N5O20 |
| Net Charge | 0 |
| Average Mass | 1110.092 |
| Monoisotopic Mass | 1109.37534 |
| SMILES | CO[C@@H]1[C@@H](OC(=O)c2ccc(C)n2)[C@@H](O)[C@H](Oc2ccc3c(O)c(NC(=O)c4cnc(C(=O)Nc5c(O)c6ccc(O[C@@H]7OC(C)(C)[C@H](OC)[C@@H](OC(=O)c8ccc(C)n8)[C@H]7O)c(C)c6oc5=O)c4C)c(=O)oc3c2C)OC1(C)C |
| InChI | InChI=1S/C55H59N5O20/c1-21-12-16-29(57-21)48(67)77-42-38(63)52(79-54(6,7)44(42)71-10)73-31-18-14-26-36(61)34(50(69)75-40(26)24(31)4)59-46(65)28-20-56-33(23(28)3)47(66)60-35-37(62)27-15-19-32(25(5)41(27)76-51(35)70)74-53-39(64)43(45(72-11)55(8,9)80-53)78-49(68)30-17-13-22(2)58-30/h12-20,38-39,42-45,52-53,56-58,61-64H,1-11H3,(H,59,65)(H,60,66)/t38-,39-,42+,43+,44-,45-,52-,53-/m1/s1 |
| InChIKey | WTIJXIZOODAMJT-DHFGXMAYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces rishiriensis (ncbitaxon:68264) | - | PubMed (24079980) |
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. DNA synthesis inhibitor Any substance that inhibits the synthesis of DNA. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. topoisomerase IV inhibitor A topoisomerase inhibitor that inhibits DNA topoisomerase IV, which catalyses ATP-dependent breakage of both strands of DNA, passage of the unbroken strands through the breaks, and rejoining of the broken strands. Hsp90 inhibitor An EC 3.6.4.10 (non-chaperonin molecular chaperone ATPase) inhibitor that blocks the action of heat shock protein 90. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| coumermycin A1 (CHEBI:3907) has role antimicrobial agent (CHEBI:33281) |
| coumermycin A1 (CHEBI:3907) has role antineoplastic agent (CHEBI:35610) |
| coumermycin A1 (CHEBI:3907) has role bacterial metabolite (CHEBI:76969) |
| coumermycin A1 (CHEBI:3907) has role DNA synthesis inhibitor (CHEBI:59517) |
| coumermycin A1 (CHEBI:3907) has role Hsp90 inhibitor (CHEBI:63962) |
| coumermycin A1 (CHEBI:3907) has role topoisomerase IV inhibitor (CHEBI:53559) |
| coumermycin A1 (CHEBI:3907) is a aromatic amide (CHEBI:62733) |
| coumermycin A1 (CHEBI:3907) is a coumarins (CHEBI:23403) |
| coumermycin A1 (CHEBI:3907) is a glycoside (CHEBI:24400) |
| coumermycin A1 (CHEBI:3907) is a heteroarenecarboxylate ester (CHEBI:38064) |
| coumermycin A1 (CHEBI:3907) is a pyrroles (CHEBI:26455) |
| IUPAC Name |
|---|
| (3-methyl-1H-pyrrole-2,4-diyl)bis[carbonylimino(4-hydroxy-8-methyl-2-oxo-2H-chromene-3,7-diyl)oxy(2R,3R,4S,5R)-3-hydroxy-5-methoxy-6,6-dimethyltetrahydro-2H-pyran-2,4-diyl] bis(5-methyl-1H-pyrrole-2-carboxylate) |
| INNs | Source |
|---|---|
| cumamicina | ChemIDplus |
| coumamycinum | ChemIDplus |
| coumamycine | ChemIDplus |
| Synonyms | Source |
|---|---|
| Coumermycin | KEGG COMPOUND |
| Notomycin A1 | ChemIDplus |
| Notomycin | ChemIDplus |
| NSC 107412 | ChemIDplus |
| Sugordomycin D-1a | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C05073 | KEGG COMPOUND |
| C00002461 | KNApSAcK |
| D02333 | KEGG DRUG |
| Coumermycin_A1 | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5230975 | Reaxys |
| CAS:4434-05-3 | KEGG COMPOUND |
| CAS:4434-05-3 | ChemIDplus |
| Citations |
|---|