EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C55H59N5O20 |
| Net Charge | 0 |
| Average Mass | 1110.092 |
| Monoisotopic Mass | 1109.37534 |
| SMILES | CO[C@@H]1[C@@H](OC(=O)c2ccc(C)n2)[C@@H](O)[C@H](Oc2ccc3c(O)c(NC(=O)c4cnc(C(=O)Nc5c(O)c6ccc(O[C@@H]7OC(C)(C)[C@H](OC)[C@@H](OC(=O)c8ccc(C)n8)[C@H]7O)c(C)c6oc5=O)c4C)c(=O)oc3c2C)OC1(C)C |
| InChI | InChI=1S/C55H59N5O20/c1-21-12-16-29(57-21)48(67)77-42-38(63)52(79-54(6,7)44(42)71-10)73-31-18-14-26-36(61)34(50(69)75-40(26)24(31)4)59-46(65)28-20-56-33(23(28)3)47(66)60-35-37(62)27-15-19-32(25(5)41(27)76-51(35)70)74-53-39(64)43(45(72-11)55(8,9)80-53)78-49(68)30-17-13-22(2)58-30/h12-20,38-39,42-45,52-53,56-58,61-64H,1-11H3,(H,59,65)(H,60,66)/t38-,39-,42+,43+,44-,45-,52-,53-/m1/s1 |
| InChIKey | WTIJXIZOODAMJT-DHFGXMAYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces rishiriensis (ncbitaxon:68264) | - | PubMed (24079980) |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. topoisomerase IV inhibitor A topoisomerase inhibitor that inhibits DNA topoisomerase IV, which catalyses ATP-dependent breakage of both strands of DNA, passage of the unbroken strands through the breaks, and rejoining of the broken strands. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. Hsp90 inhibitor An EC 3.6.4.10 (non-chaperonin molecular chaperone ATPase) inhibitor that blocks the action of heat shock protein 90. DNA synthesis inhibitor Any substance that inhibits the synthesis of DNA. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| coumermycin A1 (CHEBI:3907) has role antimicrobial agent (CHEBI:33281) |
| coumermycin A1 (CHEBI:3907) has role antineoplastic agent (CHEBI:35610) |
| coumermycin A1 (CHEBI:3907) has role bacterial metabolite (CHEBI:76969) |
| coumermycin A1 (CHEBI:3907) has role DNA synthesis inhibitor (CHEBI:59517) |
| coumermycin A1 (CHEBI:3907) has role Hsp90 inhibitor (CHEBI:63962) |
| coumermycin A1 (CHEBI:3907) has role topoisomerase IV inhibitor (CHEBI:53559) |
| coumermycin A1 (CHEBI:3907) is a aromatic amide (CHEBI:62733) |
| coumermycin A1 (CHEBI:3907) is a coumarins (CHEBI:23403) |
| coumermycin A1 (CHEBI:3907) is a glycoside (CHEBI:24400) |
| coumermycin A1 (CHEBI:3907) is a heteroarenecarboxylate ester (CHEBI:38064) |
| coumermycin A1 (CHEBI:3907) is a pyrroles (CHEBI:26455) |
| IUPAC Name |
|---|
| (3-methyl-1H-pyrrole-2,4-diyl)bis[carbonylimino(4-hydroxy-8-methyl-2-oxo-2H-chromene-3,7-diyl)oxy(2R,3R,4S,5R)-3-hydroxy-5-methoxy-6,6-dimethyltetrahydro-2H-pyran-2,4-diyl] bis(5-methyl-1H-pyrrole-2-carboxylate) |
| INNs | Source |
|---|---|
| coumamycine | ChemIDplus |
| coumamycinum | ChemIDplus |
| cumamicina | ChemIDplus |
| Synonyms | Source |
|---|---|
| Coumermycin | KEGG COMPOUND |
| Notomycin | ChemIDplus |
| Notomycin A1 | ChemIDplus |
| NSC 107412 | ChemIDplus |
| Sugordomycin D-1a | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C00002461 | KNApSAcK |
| C05073 | KEGG COMPOUND |
| Coumermycin_A1 | Wikipedia |
| D02333 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5230975 | Reaxys |
| CAS:4434-05-3 | ChemIDplus |
| CAS:4434-05-3 | KEGG COMPOUND |
| Citations |
|---|