EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H10N2O4S |
| Net Charge | 0 |
| Average Mass | 182.201 |
| Monoisotopic Mass | 182.03613 |
| SMILES | [H][N+]([H])(CCS(=O)(=O)[O-])CC(N)=O |
| InChI | InChI=1S/C4H10N2O4S/c5-4(7)3-6-1-2-11(8,9)10/h6H,1-3H2,(H2,5,7)(H,8,9,10) |
| InChIKey | DBXNUXBLKRLWFA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Good's buffer substance Any member of a collection of zwitterionic buffer substances selected or devised for suitability in experimental biological systems according to a number of predetermined criteria. Named after Dr. Norman Good. |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-[(2-amino-2-oxoethyl)ammonio]ethanesulfonate (CHEBI:39062) is a 1,1-diunsubstituted alkanesulfonate (CHEBI:62081) |
| 2-[(2-amino-2-oxoethyl)ammonio]ethanesulfonate (CHEBI:39062) is a ACES (CHEBI:39061) |
| 2-[(2-amino-2-oxoethyl)ammonio]ethanesulfonate (CHEBI:39062) is tautomer of N-(2-acetamido)-2-aminoethanesulfonic acid (CHEBI:39060) |
| Incoming Relation(s) |
| N-(2-acetamido)-2-aminoethanesulfonic acid (CHEBI:39060) is tautomer of 2-[(2-amino-2-oxoethyl)ammonio]ethanesulfonate (CHEBI:39062) |
| IUPAC Name |
|---|
| 2-[(2-amino-2-oxoethyl)ammonio]ethanesulfonate |