EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H6NO6 |
| Net Charge | -4 |
| Average Mass | 188.115 |
| Monoisotopic Mass | 188.02171 |
| SMILES | O=C([O-])C[N-](CC(=O)[O-])CC(=O)[O-] |
| InChI | InChI=1S/C6H9NO6/c8-4(9)1-7(2-5(10)11)3-6(12)13/h1-3H2,(H,8,9)(H,10,11)(H,12,13)/q-1/p-3 |
| InChIKey | RRLLGPZPXVCYCO-UHFFFAOYSA-K |
| Roles Classification |
|---|
| Chemical Roles: | chelator A ligand with two or more separate binding sites that can bind to a single metallic central atom, forming a chelate. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nitrilotriacetate(•4−) (CHEBI:39058) is a NTA (CHEBI:39054) |
| IUPAC Name |
|---|
| tris(carboxylatomethyl)azanuidyl |
| Synonym | Source |
|---|---|
| tris(carboxylatomethylene)azanuidyl | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Gmelin:1242923 | Gmelin |