EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H7NO6 |
| Net Charge | -2 |
| Average Mass | 189.123 |
| Monoisotopic Mass | 189.02843 |
| SMILES | O=C([O-])CN(CC(=O)[O-])CC(=O)O |
| InChI | InChI=1S/C6H9NO6/c8-4(9)1-7(2-5(10)11)3-6(12)13/h1-3H2,(H,8,9)(H,10,11)(H,12,13)/p-2 |
| InChIKey | MGFYIUFZLHCRTH-UHFFFAOYSA-L |
| Roles Classification |
|---|
| Chemical Roles: | chelator A ligand with two or more separate binding sites that can bind to a single metallic central atom, forming a chelate. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,2'-[(carboxymethyl)imino]diacetate (CHEBI:39055) is a nitrilotriacetate(2−) (CHEBI:39056) |
| 2,2'-[(carboxymethyl)imino]diacetate (CHEBI:39055) is tautomer of 2,2',2''-ammoniotriacetate (CHEBI:39057) |
| Incoming Relation(s) |
| 2,2',2''-ammoniotriacetate (CHEBI:39057) is tautomer of 2,2'-[(carboxymethyl)imino]diacetate (CHEBI:39055) |
| IUPAC Name |
|---|
| 2,2'-[(carboxymethyl)imino]diacetate |
| Synonym | Source |
|---|---|
| [(carboxymethyl)imino]diacetate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3907739 | Beilstein |
| Gmelin:50721 | Gmelin |