EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H15NO5S |
| Net Charge | 0 |
| Average Mass | 213.255 |
| Monoisotopic Mass | 213.06709 |
| SMILES | [H][N+](CCO)(CCO)CCS(=O)(=O)[O-] |
| InChI | InChI=1S/C6H15NO5S/c8-4-1-7(2-5-9)3-6-13(10,11)12/h8-9H,1-6H2,(H,10,11,12) |
| InChIKey | AJTVSSFTXWNIRG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Good's buffer substance Any member of a collection of zwitterionic buffer substances selected or devised for suitability in experimental biological systems according to a number of predetermined criteria. Named after Dr. Norman Good. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-[bis(2-hydroxyethyl)ammonio]ethanesulfonate (CHEBI:39045) is a 1,1-diunsubstituted alkanesulfonate (CHEBI:62081) |
| 2-[bis(2-hydroxyethyl)ammonio]ethanesulfonate (CHEBI:39045) is a BES (CHEBI:39043) |
| 2-[bis(2-hydroxyethyl)ammonio]ethanesulfonate (CHEBI:39045) is conjugate acid of 2-[bis(2-hydroxyethyl)amino]ethanesulfonate (CHEBI:39046) |
| 2-[bis(2-hydroxyethyl)ammonio]ethanesulfonate (CHEBI:39045) is tautomer of 2-[bis(2-hydroxyethyl)amino]ethanesulfonic acid (CHEBI:39041) |
| Incoming Relation(s) |
| 2-[bis(2-hydroxyethyl)amino]ethanesulfonate (CHEBI:39046) is conjugate base of 2-[bis(2-hydroxyethyl)ammonio]ethanesulfonate (CHEBI:39045) |
| 2-[bis(2-hydroxyethyl)amino]ethanesulfonic acid (CHEBI:39041) is tautomer of 2-[bis(2-hydroxyethyl)ammonio]ethanesulfonate (CHEBI:39045) |
| IUPAC Name |
|---|
| 2-[bis(2-hydroxyethyl)ammonio]ethanesulfonate |