EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H15NO6S |
| Net Charge | 0 |
| Average Mass | 229.254 |
| Monoisotopic Mass | 229.06201 |
| SMILES | [H][N+]([H])(CCS(=O)(=O)[O-])C(CO)(CO)CO |
| InChI | InChI=1S/C6H15NO6S/c8-3-6(4-9,5-10)7-1-2-14(11,12)13/h7-10H,1-5H2,(H,11,12,13) |
| InChIKey | JOCBASBOOFNAJA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Good's buffer substance Any member of a collection of zwitterionic buffer substances selected or devised for suitability in experimental biological systems according to a number of predetermined criteria. Named after Dr. Norman Good. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-tris(hydroxymethyl)methyl-2-ammonioethanesulfonate (CHEBI:39036) is a TES (CHEBI:39035) |
| N-tris(hydroxymethyl)methyl-2-ammonioethanesulfonate (CHEBI:39036) is tautomer of N-tris(hydroxymethyl)methyl-2-aminoethanesulfonic acid (CHEBI:44356) |
| Incoming Relation(s) |
| N-tris(hydroxymethyl)methyl-2-aminoethanesulfonic acid (CHEBI:44356) is tautomer of N-tris(hydroxymethyl)methyl-2-ammonioethanesulfonate (CHEBI:39036) |
| IUPAC Name |
|---|
| 2-{[2-hydroxy-1,1-bis(hydroxymethyl)ethyl]ammonio}ethanesulfonate |
| Synonym | Source |
|---|---|
| TES buffer | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3958939 | Beilstein |