EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:38990 - vamidothion
| Formula | C8H18NO4PS2 |
| Net Charge | 0 |
| Average Mass | 287.343 |
| Monoisotopic Mass | 287.04149 |
| SMILES | CNC(=O)C(C)SCCSP(=O)(OC)OC |
| InChI | InChI=1S/C8H18NO4PS2/c1-7(8(10)9-2)15-5-6-16-14(11,12-3)13-4/h7H,5-6H2,1-4H3,(H,9,10) |
| InChIKey | LESVOLZBIFDZGS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). agrochemical An agrochemical is a substance that is used in agriculture or horticulture. insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vamidothion (CHEBI:38990) has functional parent 2-((2-hydroxyethyl)sulfanyl)-N-methylpropionamide (CHEBI:38996) |
| vamidothion (CHEBI:38990) has role acaricide (CHEBI:22153) |
| vamidothion (CHEBI:38990) has role agrochemical (CHEBI:33286) |
| vamidothion (CHEBI:38990) has role antibacterial agent (CHEBI:33282) |
| vamidothion (CHEBI:38990) has role antifungal agent (CHEBI:35718) |
| vamidothion (CHEBI:38990) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| vamidothion (CHEBI:38990) is a organic thiophosphate (CHEBI:37512) |
| vamidothion (CHEBI:38990) is a organothiophosphate insecticide (CHEBI:25715) |
| IUPAC Name |
|---|
| O,O-dimethyl S-(2-{[1-methyl-2-(methylamino)-2-oxoethyl]sulfanyl}ethyl) phosphorothioate |
| Synonyms | Source |
|---|---|
| Dimethyl S-(2-(1-methylcarbamoylethylthio)ethyl) phosphorothiolate | ChemIDplus |
| O,O-dimethyl S-(2-{[1-methyl-2-(methylamino)-2-oxoethyl]sulfanyl}ethyl) thiophosphate | IUPAC |
| O,O-Dimethyl S-(2-(1-methylcarbamoylethylthio)ethyl) phosphorothioate | ChemIDplus |
| Vamidoate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 678 | PPDB |
| C18666 | KEGG COMPOUND |
| vamidothion | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2651123 | Reaxys |
| CAS:2275-23-2 | ChemIDplus |
| CAS:2275-23-2 | KEGG COMPOUND |