EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H18NO4PS2 |
| Net Charge | 0 |
| Average Mass | 287.343 |
| Monoisotopic Mass | 287.04149 |
| SMILES | CNC(=O)C(C)SCCSP(=O)(OC)OC |
| InChI | InChI=1S/C8H18NO4PS2/c1-7(8(10)9-2)15-5-6-16-14(11,12-3)13-4/h7H,5-6H2,1-4H3,(H,9,10) |
| InChIKey | LESVOLZBIFDZGS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vamidothion (CHEBI:38990) has functional parent 2-((2-hydroxyethyl)sulfanyl)-N-methylpropionamide (CHEBI:38996) |
| vamidothion (CHEBI:38990) has role acaricide (CHEBI:22153) |
| vamidothion (CHEBI:38990) has role agrochemical (CHEBI:33286) |
| vamidothion (CHEBI:38990) has role antibacterial agent (CHEBI:33282) |
| vamidothion (CHEBI:38990) has role antifungal agent (CHEBI:35718) |
| vamidothion (CHEBI:38990) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| vamidothion (CHEBI:38990) is a organic thiophosphate (CHEBI:37512) |
| vamidothion (CHEBI:38990) is a organothiophosphate insecticide (CHEBI:25715) |
| IUPAC Name |
|---|
| O,O-dimethyl S-(2-{[1-methyl-2-(methylamino)-2-oxoethyl]sulfanyl}ethyl) phosphorothioate |
| Synonyms | Source |
|---|---|
| Dimethyl S-(2-(1-methylcarbamoylethylthio)ethyl) phosphorothiolate | ChemIDplus |
| O,O-dimethyl S-(2-{[1-methyl-2-(methylamino)-2-oxoethyl]sulfanyl}ethyl) thiophosphate | IUPAC |
| O,O-Dimethyl S-(2-(1-methylcarbamoylethylthio)ethyl) phosphorothioate | ChemIDplus |
| Vamidoate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 678 | PPDB |
| C18666 | KEGG COMPOUND |
| vamidothion | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2651123 | Reaxys |
| CAS:2275-23-2 | ChemIDplus |
| CAS:2275-23-2 | KEGG COMPOUND |