EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:3897 - Cortisone acetate
| Formula | C23H30O6 |
| Net Charge | 0 |
| Average Mass | 402.487 |
| Monoisotopic Mass | 402.20424 |
| SMILES | [H][C@@]12CC[C@](O)(C(=O)COC(C)=O)[C@@]1(C)CC(=O)[C@@]1([H])[C@@]2([H])CCC2=CC(=O)CC[C@@]21C |
| InChI | InChI=1S/C23H30O6/c1-13(24)29-12-19(27)23(28)9-7-17-16-5-4-14-10-15(25)6-8-21(14,2)20(16)18(26)11-22(17,23)3/h10,16-17,20,28H,4-9,11-12H2,1-3H3/t16-,17-,20+,21-,22-,23-/m0/s1 |
| InChIKey | ITRJWOMZKQRYTA-RFZYENFJSA-N |
| Roles Classification |
|---|
| Biological Roles: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. anti-inflammatory agent Any compound that has anti-inflammatory effects. anti-asthmatic agent Any compound that has anti-asthmatic effects. anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. dermatologic drug A drug used to treat or prevent skin disorders or for the routine care of skin. antirheumatic drug A drug used to treat rheumatoid arthritis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cortisone acetate (CHEBI:3897) has role anti-anaemic agent (CHEBI:75835) |
| Cortisone acetate (CHEBI:3897) has role anti-asthmatic agent (CHEBI:65023) |
| Cortisone acetate (CHEBI:3897) has role anti-inflammatory agent (CHEBI:67079) |
| Cortisone acetate (CHEBI:3897) has role anti-ulcer drug (CHEBI:49201) |
| Cortisone acetate (CHEBI:3897) has role antimicrobial agent (CHEBI:33281) |
| Cortisone acetate (CHEBI:3897) has role antineoplastic agent (CHEBI:35610) |
| Cortisone acetate (CHEBI:3897) has role antirheumatic drug (CHEBI:35842) |
| Cortisone acetate (CHEBI:3897) has role antitubercular agent (CHEBI:33231) |
| Cortisone acetate (CHEBI:3897) has role dermatologic drug (CHEBI:50177) |
| Cortisone acetate (CHEBI:3897) has role ophthalmology drug (CHEBI:66981) |
| Cortisone acetate (CHEBI:3897) is a corticosteroid hormone (CHEBI:36699) |
| INN | Source |
|---|---|
| cortisona | WHO MedNet |
| Synonyms | Source |
|---|---|
| adrenalex | DrugCentral |
| Cortisone 21-acetate | ChEMBL |
| Cortisone acetate | KEGG COMPOUND |
| Cortisone aceticum | ChEMBL |
| Cortisyl | KEGG COMPOUND |
| cortone acetate | DrugCentral |
| Brand Names | Source |
|---|---|
| Cortate | ChEMBL |
| Cortelan | ChEMBL |
| Cortistab | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 734 | DrugCentral |
| C08173 | KEGG COMPOUND |
| D00973 | KEGG DRUG |
| HMDB0015459 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:50-04-4 | KEGG COMPOUND |
| Citations |
|---|