EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H16N3O3PS |
| Net Charge | 0 |
| Average Mass | 313.319 |
| Monoisotopic Mass | 313.06500 |
| SMILES | CCOP(=S)(OCC)Oc1ncn(-c2ccccc2)n1 |
| InChI | InChI=1S/C12H16N3O3PS/c1-3-16-19(20,17-4-2)18-12-13-10-15(14-12)11-8-6-5-7-9-11/h5-10H,3-4H2,1-2H3 |
| InChIKey | AMFGTOFWMRQMEM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. |
| Applications: | acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). nematicide A substance used to destroy pests of the phylum Nematoda (roundworms). agrochemical An agrochemical is a substance that is used in agriculture or horticulture. insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| triazophos (CHEBI:38963) has functional parent 1-phenyl-1H-1,2,4-triazol-3-ol (CHEBI:38966) |
| triazophos (CHEBI:38963) has role acaricide (CHEBI:22153) |
| triazophos (CHEBI:38963) has role agrochemical (CHEBI:33286) |
| triazophos (CHEBI:38963) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| triazophos (CHEBI:38963) has role nematicide (CHEBI:25491) |
| triazophos (CHEBI:38963) is a organic thiophosphate (CHEBI:37512) |
| triazophos (CHEBI:38963) is a organothiophosphate insecticide (CHEBI:25715) |
| IUPAC Name |
|---|
| O,O-diethyl O-(1-phenyl-1H-1,2,4-triazol-3-yl) phosphorothioate |
| Synonyms | Source |
|---|---|
| 1-Phenyl-1,2,4-triazolyl-3-(O,O-diethylthionophosphate) | ChemIDplus |
| O,O-diethyl O-(1-phenyl-1H-1,2,4-triazol-3-yl) thiophosphate | IUPAC |
| Hostathion | NIST Chemistry WebBook |
| Methoxone | NIST Chemistry WebBook |
| Phosphorothioic acid, O,O-diethyl O-(1-phenyl-1H-1,2,4-triazol-3-yl) ester | ChemIDplus |
| Triazofos | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:24017-47-8 | ChemIDplus |
| CAS:24017-47-8 | NIST Chemistry WebBook |
| CAS:24017-47-8 | KEGG COMPOUND |