EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:38951 - tebupirimfos
| Formula | C13H23N2O3PS |
| Net Charge | 0 |
| Average Mass | 318.379 |
| Monoisotopic Mass | 318.11670 |
| SMILES | CCOP(=S)(Oc1cnc(C(C)(C)C)nc1)OC(C)C |
| InChI | InChI=1S/C13H23N2O3PS/c1-7-16-19(20,17-10(2)3)18-11-8-14-12(15-9-11)13(4,5)6/h8-10H,7H2,1-6H3 |
| InChIKey | AWYOMXWDGWUJHS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. |
| Applications: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tebupirimfos (CHEBI:38951) has functional parent 2-tert-butylpyrimidin-5-ol (CHEBI:38952) |
| tebupirimfos (CHEBI:38951) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| tebupirimfos (CHEBI:38951) is a organic thiophosphate (CHEBI:37512) |
| tebupirimfos (CHEBI:38951) is a organothiophosphate insecticide (CHEBI:25715) |
| IUPAC Name |
|---|
| O-(2-tert-butylpyrimidin-5-yl) O-ethyl O-(propan-2-yl) phosphorothioate |
| Synonyms | Source |
|---|---|
| O-(2-tert-butylpyrimidin-5-yl) O-ethyl O-isopropyl thiophosphate | IUPAC |
| O-(2-(1,1-Dimethylethyl)-5-pyrimidinyl) O-ethyl O-(1-methylethyl) phosphorothioate | ChemIDplus |
| Phosphorothioic acid, O-(2-(1,1-dimethylethyl)-5-pyrimidinyl) O-ethyl O-(1-methylethyl) ester | ChemIDplus |
| Phostebupirim | ChemIDplus |
| Tebupirimphos | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:96182-53-5 | ChemIDplus |
| CAS:96182-53-5 | KEGG COMPOUND |