EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H4O4S2Sb.Na |
| Net Charge | 0 |
| Average Mass | 324.956 |
| Monoisotopic Mass | 323.84869 |
| SMILES | O=C([O-])C[S][Sb]1[O]C(=O)C[S]1.[Na+] |
| InChI | InChI=1S/2C2H4O2S.Na.Sb/c2*3-2(4)1-5;;/h2*5H,1H2,(H,3,4);;/q;;+1;+3/p-4 |
| InChIKey | CKNQDJJWKSXPRU-UHFFFAOYSA-J |
| Roles Classification |
|---|
| Application: | schistosomicide drug Drugs that used to treat infestations by flukes (trematodes) of the genus Schistosoma. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| antimony sodium thioglycollate (CHEBI:38939) has role schistosomicide drug (CHEBI:38941) |
| antimony sodium thioglycollate (CHEBI:38939) is a antimony molecular entity (CHEBI:36919) |
| IUPAC Name |
|---|
| sodium [(5-oxo-1,3,2-oxathiastibolan-2-yl)thio]acetate |
| Synonyms | Source |
|---|---|
| antimony sodium thioglycollate | ChemIDplus |
| ((5-oxo-1,3,2-oxathiastibolan-2-yl)thio)acetic acid, sodium salt | ChemIDplus |
| antimony sodium thioacetate | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:539-54-8 | ChemIDplus |