EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H26ClN7O |
| Net Charge | 0 |
| Average Mass | 403.918 |
| Monoisotopic Mass | 403.18874 |
| SMILES | CC(C)[C@H](CO)Nc1nc(Nc2cc(N)cc(Cl)c2)c2ncn(C(C)C)c2n1 |
| InChI | InChI=1S/C19H26ClN7O/c1-10(2)15(8-28)24-19-25-17(23-14-6-12(20)5-13(21)7-14)16-18(26-19)27(9-22-16)11(3)4/h5-7,9-11,15,28H,8,21H2,1-4H3,(H2,23,24,25,26)/t15-/m0/s1 |
| InChIKey | RAMROQQYRRQPDL-HNNXBMFYSA-N |
| Roles Classification |
|---|
| Biological Role: | protein kinase inhibitor An EC 2.7.* (P-containing group transferase) inhibitor that interferes with the action of protein kinases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aminopurvalanol (CHEBI:38937) has role protein kinase inhibitor (CHEBI:37699) |
| aminopurvalanol (CHEBI:38937) is a monochlorobenzenes (CHEBI:83403) |
| aminopurvalanol (CHEBI:38937) is a purvalanol (CHEBI:38934) |
| IUPAC Name |
|---|
| (2R)-2-({6-[(3-amino-5-chlorophenyl)amino]-9-(propan-2-yl)-9H-purin-2-yl}amino)-3-methylbutan-1-ol |
| Synonym | Source |
|---|---|
| aminopurvalanol A | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LSM-2151 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Beilstein:9293320 | Beilstein |