EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H23ClFN5O2 |
| Net Charge | 0 |
| Average Mass | 467.932 |
| Monoisotopic Mass | 467.15243 |
| SMILES | CCOc1cc2ncc(C#N)c(Nc3ccc(F)c(Cl)c3)c2cc1NC(=O)/C=C/CN(C)C |
| InChI | InChI=1S/C24H23ClFN5O2/c1-4-33-22-12-20-17(11-21(22)30-23(32)6-5-9-31(2)3)24(15(13-27)14-28-20)29-16-7-8-19(26)18(25)10-16/h5-8,10-12,14H,4,9H2,1-3H3,(H,28,29)(H,30,32)/b6-5+ |
| InChIKey | WVUNYSQLFKLYNI-AATRIKPKSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | protein kinase inhibitor An EC 2.7.* (P-containing group transferase) inhibitor that interferes with the action of protein kinases. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pelitinib (CHEBI:38927) has role antineoplastic agent (CHEBI:35610) |
| pelitinib (CHEBI:38927) has role protein kinase inhibitor (CHEBI:37699) |
| pelitinib (CHEBI:38927) is a aminoquinoline (CHEBI:36709) |
| pelitinib (CHEBI:38927) is a monocarboxylic acid amide (CHEBI:29347) |
| pelitinib (CHEBI:38927) is a monochlorobenzenes (CHEBI:83403) |
| pelitinib (CHEBI:38927) is a nitrile (CHEBI:18379) |
| Incoming Relation(s) |
| linkable pelitinib analogue (CHEBI:39085) has functional parent pelitinib (CHEBI:38927) |
| IUPAC Name |
|---|
| (2E)-N-{4-[(3-chloro-4-fluorophenyl)amino]-3-cyano-7-ethoxyquinolin-6-yl}-4-(dimethylamino)but-2-enamide |
| Synonyms | Source |
|---|---|
| (2E)-N-(4-((3-chloro-4-fluorophenyl)amino)-3-cyano-7-ethoxy-6-quinolinyl)-4-(dimethylamino)-2-butenamide | ChemIDplus |
| EKB-569 | ChemIDplus |
| Pelitinib | ChemIDplus |
| WAY-EKB-569 | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| CAS:257933-82-7 | ChemIDplus |
| Citations |
|---|