EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H23N5O2S |
| Net Charge | 0 |
| Average Mass | 457.559 |
| Monoisotopic Mass | 457.15725 |
| SMILES | Cn1cc(C2=C(c3cn(CCCSC(=N)N)c4ccccc34)C(=O)NC2=O)c2ccccc21 |
| InChI | InChI=1S/C25H23N5O2S/c1-29-13-17(15-7-2-4-9-19(15)29)21-22(24(32)28-23(21)31)18-14-30(11-6-12-33-25(26)27)20-10-5-3-8-16(18)20/h2-5,7-10,13-14H,6,11-12H2,1H3,(H3,26,27)(H,28,31,32) |
| InChIKey | DSXXEELGXBCYNQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 2.7.11.13 (protein kinase C) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of protein kinase C (EC 2.7.11.13). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ro 31-8220 (CHEBI:38912) has functional parent maleimide (CHEBI:16072) |
| Ro 31-8220 (CHEBI:38912) has role EC 2.7.11.13 (protein kinase C) inhibitor (CHEBI:37700) |
| Ro 31-8220 (CHEBI:38912) is a imidothiocarbamic ester (CHEBI:38914) |
| Ro 31-8220 (CHEBI:38912) is a indoles (CHEBI:24828) |
| Ro 31-8220 (CHEBI:38912) is a maleimides (CHEBI:55417) |
| IUPAC Name |
|---|
| 3-{3-[4-(1-methyl-1H-indol-3-yl)-2,5-dioxo-2,5-dihydro-1H-pyrrol-3-yl]-1H-indol-1-yl}propyl carbamimidothioate |
| Synonyms | Source |
|---|---|
| 3-{3-[4-(1-methyl-1H-indol-3-yl)-2,5-dioxo-2,5-dihydro-1H-pyrrol-3-yl]-1H-indol-1-yl}propyl imidothiocarbamate | IUPAC |
| Ro 31 8220 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| LSM-2125 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5366323 | Beilstein |
| CAS:125314-64-9 | ChemIDplus |