EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H15NO2 |
| Net Charge | 0 |
| Average Mass | 193.246 |
| Monoisotopic Mass | 193.11028 |
| SMILES | CNC(=O)Oc1cc(C)cc(C)c1C |
| InChI | InChI=1S/C11H15NO2/c1-7-5-8(2)9(3)10(6-7)14-11(13)12-4/h5-6H,1-4H3,(H,12,13) |
| InChIKey | NYOKZHDTNBDPOB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. agrochemical An agrochemical is a substance that is used in agriculture or horticulture. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,3,5-trimethylphenyl methylcarbamate (CHEBI:38893) has functional parent 2,3,5-trimethylphenol (CHEBI:38570) |
| 2,3,5-trimethylphenyl methylcarbamate (CHEBI:38893) has role agrochemical (CHEBI:33286) |
| 2,3,5-trimethylphenyl methylcarbamate (CHEBI:38893) has role insecticide (CHEBI:24852) |
| 2,3,5-trimethylphenyl methylcarbamate (CHEBI:38893) is a carbamate ester (CHEBI:23003) |
| Incoming Relation(s) |
| trimethacarb (CHEBI:38569) has part 2,3,5-trimethylphenyl methylcarbamate (CHEBI:38893) |
| IUPAC Name |
|---|
| 2,3,5-trimethylphenyl methylcarbamate |
| Synonyms | Source |
|---|---|
| 2,3,5-Trimethylphenol methylcarbamate | ChemIDplus |
| 2,3,5-Trimethylphenyl N-methylcarbamate | NIST Chemistry WebBook |
| methylcarbamic acid 2,3,5-trimethylphenyl ester | ChEBI |