EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:38887 - pyridalyl
| Formula | C18H14Cl4F3NO3 |
| Net Charge | 0 |
| Average Mass | 491.120 |
| Monoisotopic Mass | 488.96799 |
| SMILES | FC(F)(F)c1ccc(OCCCOc2c(Cl)cc(OCC=C(Cl)Cl)cc2Cl)nc1 |
| InChI | InChI=1S/C18H14Cl4F3NO3/c19-13-8-12(27-7-4-15(21)22)9-14(20)17(13)29-6-1-5-28-16-3-2-11(10-26-16)18(23,24)25/h2-4,8-10H,1,5-7H2 |
| InChIKey | AEHJMNVBLRLZKK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pyridalyl (CHEBI:38887) is a dichlorobenzene (CHEBI:23697) |
| pyridalyl (CHEBI:38887) is a organochlorine insecticide (CHEBI:25705) |
| pyridalyl (CHEBI:38887) is a organofluorine insecticide (CHEBI:38804) |
| IUPAC Name |
|---|
| 2-(3-{2,6-dichloro-4-[(3,3-dichloroprop-2-en-1-yl)oxy]phenoxy}propoxy)-5-(trifluoromethyl)pyridine |
| Synonym | Source |
|---|---|
| pyridalyl | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:179101-81-6 | ChemIDplus |
| CAS:179101-81-6 | KEGG COMPOUND |