EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H15Cl2O2PS2 |
| Net Charge | 0 |
| Average Mass | 345.253 |
| Monoisotopic Mass | 343.96281 |
| SMILES | CCCSP(=S)(OCC)Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H15Cl2O2PS2/c1-3-7-18-16(17,14-4-2)15-11-6-5-9(12)8-10(11)13/h5-6,8H,3-4,7H2,1-2H3 |
| InChIKey | FITIWKDOCAUBQD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 3.1.1.8 (cholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of cholinesterase (EC 3.1.1.8). EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| prothiofos (CHEBI:38873) has functional parent 2,4-dichlorophenol (CHEBI:16738) |
| prothiofos (CHEBI:38873) has role agrochemical (CHEBI:33286) |
| prothiofos (CHEBI:38873) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| prothiofos (CHEBI:38873) has role EC 3.1.1.8 (cholinesterase) inhibitor (CHEBI:37733) |
| prothiofos (CHEBI:38873) has role insecticide (CHEBI:24852) |
| prothiofos (CHEBI:38873) is a dichlorobenzene (CHEBI:23697) |
| prothiofos (CHEBI:38873) is a organic thiophosphate (CHEBI:37512) |
| prothiofos (CHEBI:38873) is a organosulfur compound (CHEBI:33261) |
| IUPAC Name |
|---|
| O-(2,4-dichlorophenyl) O-ethyl S-propyl phosphorodithionate |
| Synonyms | Source |
|---|---|
| Dichlorpropaphos | ChemIDplus |
| O-(2,4-dichlorophenyl) O-ethyl S-propyl dithiophosphate | IUPAC |
| Prothiophos | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1998314 | Reaxys |
| CAS:34643-46-4 | KEGG COMPOUND |
| CAS:34643-46-4 | NIST Chemistry WebBook |
| CAS:34643-46-4 | ChemIDplus |
| Citations |
|---|