EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H15Cl2O2PS2 |
| Net Charge | 0 |
| Average Mass | 345.253 |
| Monoisotopic Mass | 343.96281 |
| SMILES | CCCSP(=S)(OCC)Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H15Cl2O2PS2/c1-3-7-18-16(17,14-4-2)15-11-6-5-9(12)8-10(11)13/h5-6,8H,3-4,7H2,1-2H3 |
| InChIKey | FITIWKDOCAUBQD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. EC 3.1.1.8 (cholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of cholinesterase (EC 3.1.1.8). |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| prothiofos (CHEBI:38873) has functional parent 2,4-dichlorophenol (CHEBI:16738) |
| prothiofos (CHEBI:38873) has role agrochemical (CHEBI:33286) |
| prothiofos (CHEBI:38873) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| prothiofos (CHEBI:38873) has role EC 3.1.1.8 (cholinesterase) inhibitor (CHEBI:37733) |
| prothiofos (CHEBI:38873) has role insecticide (CHEBI:24852) |
| prothiofos (CHEBI:38873) is a dichlorobenzene (CHEBI:23697) |
| prothiofos (CHEBI:38873) is a organic thiophosphate (CHEBI:37512) |
| prothiofos (CHEBI:38873) is a organosulfur compound (CHEBI:33261) |
| IUPAC Name |
|---|
| O-(2,4-dichlorophenyl) O-ethyl S-propyl phosphorodithionate |
| Synonyms | Source |
|---|---|
| Prothiophos | ChemIDplus |
| Dichlorpropaphos | ChemIDplus |
| O-(2,4-dichlorophenyl) O-ethyl S-propyl dithiophosphate | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1998314 | Reaxys |
| CAS:34643-46-4 | ChemIDplus |
| CAS:34643-46-4 | NIST Chemistry WebBook |
| CAS:34643-46-4 | KEGG COMPOUND |
| Citations |
|---|