EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:3887 - (−)-coronaridine
| Formula | C21H26N2O2 |
| Net Charge | 0 |
| Average Mass | 338.451 |
| Monoisotopic Mass | 338.19943 |
| SMILES | [H][C@@]12C[C@H](CC)[C@]3([H])[N@@](CCc4c(nc5ccccc45)[C@]3(C(=O)OC)C1)C2 |
| InChI | InChI=1S/C21H26N2O2/c1-3-14-10-13-11-21(20(24)25-2)18-16(8-9-23(12-13)19(14)21)15-6-4-5-7-17(15)22-18/h4-7,13-14,19,22H,3,8-12H2,1-2H3/t13-,14+,19+,21-/m1/s1 |
| InChIKey | NVVDQMVGALBDGE-PZXGUROGSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Peschiera australis (IPNI:1083767-2) | stem (BTO:0001300) | PubMed (11302794) | |
| Tabernaemontana pandacaqui (ncbitaxon:761085) | - | PubMed (14122038) | |
| Tabernaemontana divaricata (ncbitaxon:52861) | |||
| cell suspension culture (BTO:0000221) | PubMed (17265301) | ||
| aerial part (BTO:0001658) | PubMed (26231157) | ||
| Tabernaemontana penduliflora (ncbitaxon:761088) | seed (BTO:0001226) | PubMed (17342619) | |
| Tabernaemontana catharinensis (ncbitaxon:403124) | root (BTO:0001188) | PubMed (23569415) | Isolated from root bark. |
| Tabernaemontana litoralis (ncbitaxon:403118) | fruit (BTO:0000486) | PubMed (28006917) | |
| Ervatamia pandacaqui (IPNI:78961-1) | leaf (BTO:0000713) | PubMed (29728039) | |
| Tabernaemontana ternifolia (IPNI:60439757-2) | root (BTO:0001188) | PubMed (30773907) | |
| Tabernaemontana heyneana (IPNI:82149-1) | root (BTO:0001188) | PubMed (4714135) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-coronaridine (CHEBI:3887) has role antileishmanial agent (CHEBI:70868) |
| (−)-coronaridine (CHEBI:3887) has role antineoplastic agent (CHEBI:35610) |
| (−)-coronaridine (CHEBI:3887) has role apoptosis inducer (CHEBI:68495) |
| (−)-coronaridine (CHEBI:3887) has role plant metabolite (CHEBI:76924) |
| (−)-coronaridine (CHEBI:3887) is a alkaloid ester (CHEBI:38481) |
| (−)-coronaridine (CHEBI:3887) is a methyl ester (CHEBI:25248) |
| (−)-coronaridine (CHEBI:3887) is a monoterpenoid indole alkaloid (CHEBI:65323) |
| (−)-coronaridine (CHEBI:3887) is a organic heteropentacyclic compound (CHEBI:38164) |
| (−)-coronaridine (CHEBI:3887) is conjugate base of (−)-coronaridine(1+) (CHEBI:146232) |
| Incoming Relation(s) |
| 10-hydroxycoronaridine (CHEBI:146256) has functional parent (−)-coronaridine (CHEBI:3887) |
| (−)-coronaridine(1+) (CHEBI:146232) is conjugate acid of (−)-coronaridine (CHEBI:3887) |
| IUPAC Name |
|---|
| methyl ibogamine-18-carboxylate |
| Synonyms | Source |
|---|---|
| coronaridine | KEGG COMPOUND |
| (−)-coronaridine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C09139 | KEGG COMPOUND |
| C00001709 | KNApSAcK |
| Coronaridine | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:467-77-6 | ChemIDplus |
| Citations |
|---|