EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:3887 - (−)-coronaridine
| Formula | C21H26N2O2 |
| Net Charge | 0 |
| Average Mass | 338.451 |
| Monoisotopic Mass | 338.19943 |
| SMILES | [H][C@@]12C[C@H](CC)[C@]3([H])[N@@](CCc4c(nc5ccccc45)[C@]3(C(=O)OC)C1)C2 |
| InChI | InChI=1S/C21H26N2O2/c1-3-14-10-13-11-21(20(24)25-2)18-16(8-9-23(12-13)19(14)21)15-6-4-5-7-17(15)22-18/h4-7,13-14,19,22H,3,8-12H2,1-2H3/t13-,14+,19+,21-/m1/s1 |
| InChIKey | NVVDQMVGALBDGE-PZXGUROGSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ervatamia pandacaqui (IPNI:78961-1) | leaf (BTO:0000713) | PubMed (29728039) | |
| Peschiera australis (IPNI:1083767-2) | stem (BTO:0001300) | PubMed (11302794) | |
| Tabernaemontana catharinensis (ncbitaxon:403124) | root (BTO:0001188) | PubMed (23569415) | Isolated from root bark. |
| Tabernaemontana divaricata (ncbitaxon:52861) | |||
| aerial part (BTO:0001658) | PubMed (26231157) | ||
| cell suspension culture (BTO:0000221) | PubMed (17265301) | ||
| Tabernaemontana heyneana (IPNI:82149-1) | root (BTO:0001188) | PubMed (4714135) | |
| Tabernaemontana litoralis (ncbitaxon:403118) | fruit (BTO:0000486) | PubMed (28006917) | |
| Tabernaemontana pandacaqui (ncbitaxon:761085) | - | PubMed (14122038) | |
| Tabernaemontana penduliflora (ncbitaxon:761088) | seed (BTO:0001226) | PubMed (17342619) | |
| Tabernaemontana ternifolia (IPNI:60439757-2) | root (BTO:0001188) | PubMed (30773907) |
| Roles Classification |
|---|
| Biological Roles: | antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-coronaridine (CHEBI:3887) has role antileishmanial agent (CHEBI:70868) |
| (−)-coronaridine (CHEBI:3887) has role antineoplastic agent (CHEBI:35610) |
| (−)-coronaridine (CHEBI:3887) has role apoptosis inducer (CHEBI:68495) |
| (−)-coronaridine (CHEBI:3887) has role plant metabolite (CHEBI:76924) |
| (−)-coronaridine (CHEBI:3887) is a alkaloid ester (CHEBI:38481) |
| (−)-coronaridine (CHEBI:3887) is a methyl ester (CHEBI:25248) |
| (−)-coronaridine (CHEBI:3887) is a monoterpenoid indole alkaloid (CHEBI:65323) |
| (−)-coronaridine (CHEBI:3887) is a organic heteropentacyclic compound (CHEBI:38164) |
| (−)-coronaridine (CHEBI:3887) is conjugate base of (−)-coronaridine(1+) (CHEBI:146232) |
| Incoming Relation(s) |
| 10-hydroxycoronaridine (CHEBI:146256) has functional parent (−)-coronaridine (CHEBI:3887) |
| (−)-coronaridine(1+) (CHEBI:146232) is conjugate acid of (−)-coronaridine (CHEBI:3887) |
| IUPAC Name |
|---|
| methyl ibogamine-18-carboxylate |
| Synonyms | Source |
|---|---|
| (−)-coronaridine | KEGG COMPOUND |
| coronaridine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00001709 | KNApSAcK |
| C09139 | KEGG COMPOUND |
| Coronaridine | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:467-77-6 | ChemIDplus |
| Citations |
|---|