EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:3887 - (−)-coronaridine
| Formula | C21H26N2O2 |
| Net Charge | 0 |
| Average Mass | 338.451 |
| Monoisotopic Mass | 338.19943 |
| SMILES | [H][C@@]12C[C@H](CC)[C@]3([H])[N@@](CCc4c(nc5ccccc45)[C@]3(C(=O)OC)C1)C2 |
| InChI | InChI=1S/C21H26N2O2/c1-3-14-10-13-11-21(20(24)25-2)18-16(8-9-23(12-13)19(14)21)15-6-4-5-7-17(15)22-18/h4-7,13-14,19,22H,3,8-12H2,1-2H3/t13-,14+,19+,21-/m1/s1 |
| InChIKey | NVVDQMVGALBDGE-PZXGUROGSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ervatamia pandacaqui (IPNI:78961-1) | leaf (BTO:0000713) | PubMed (29728039) | |
| Peschiera australis (IPNI:1083767-2) | stem (BTO:0001300) | PubMed (11302794) | |
| Tabernaemontana catharinensis (ncbitaxon:403124) | root (BTO:0001188) | PubMed (23569415) | Isolated from root bark. |
| Tabernaemontana divaricata (ncbitaxon:52861) | |||
| aerial part (BTO:0001658) | PubMed (26231157) | ||
| cell suspension culture (BTO:0000221) | PubMed (17265301) | ||
| Tabernaemontana heyneana (IPNI:82149-1) | root (BTO:0001188) | PubMed (4714135) | |
| Tabernaemontana litoralis (ncbitaxon:403118) | fruit (BTO:0000486) | PubMed (28006917) | |
| Tabernaemontana pandacaqui (ncbitaxon:761085) | - | PubMed (14122038) | |
| Tabernaemontana penduliflora (ncbitaxon:761088) | seed (BTO:0001226) | PubMed (17342619) | |
| Tabernaemontana ternifolia (IPNI:60439757-2) | root (BTO:0001188) | PubMed (30773907) |
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-coronaridine (CHEBI:3887) has role antileishmanial agent (CHEBI:70868) |
| (−)-coronaridine (CHEBI:3887) has role antineoplastic agent (CHEBI:35610) |
| (−)-coronaridine (CHEBI:3887) has role apoptosis inducer (CHEBI:68495) |
| (−)-coronaridine (CHEBI:3887) has role plant metabolite (CHEBI:76924) |
| (−)-coronaridine (CHEBI:3887) is a alkaloid ester (CHEBI:38481) |
| (−)-coronaridine (CHEBI:3887) is a methyl ester (CHEBI:25248) |
| (−)-coronaridine (CHEBI:3887) is a monoterpenoid indole alkaloid (CHEBI:65323) |
| (−)-coronaridine (CHEBI:3887) is a organic heteropentacyclic compound (CHEBI:38164) |
| (−)-coronaridine (CHEBI:3887) is conjugate base of (−)-coronaridine(1+) (CHEBI:146232) |
| Incoming Relation(s) |
| 10-hydroxycoronaridine (CHEBI:146256) has functional parent (−)-coronaridine (CHEBI:3887) |
| (−)-coronaridine(1+) (CHEBI:146232) is conjugate acid of (−)-coronaridine (CHEBI:3887) |
| IUPAC Name |
|---|
| methyl ibogamine-18-carboxylate |
| Synonyms | Source |
|---|---|
| (−)-coronaridine | KEGG COMPOUND |
| coronaridine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00001709 | KNApSAcK |
| C09139 | KEGG COMPOUND |
| Coronaridine | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:467-77-6 | ChemIDplus |
| Citations |
|---|