EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12F27N |
| Net Charge | 0 |
| Average Mass | 671.085 |
| Monoisotopic Mass | 670.95996 |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)N(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12F27N/c13-1(14,7(25,26)27)4(19,20)10(34,35)40(11(36,37)5(21,22)2(15,16)8(28,29)30)12(38,39)6(23,24)3(17,18)9(31,32)33 |
| InChIKey | RVZRBWKZFJCCIB-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | solvent A liquid that can dissolve other substances (solutes) without any change in their chemical composition. greenhouse gas A gas in an atmosphere that absorbs and emits radiation within the thermal infrared range, so contributing to the 'greenhouse effect'. |
| Applications: | solvent A liquid that can dissolve other substances (solutes) without any change in their chemical composition. blood substitute A substance that can carry oxygen to and carbon dioxide away from the tissues when introduced into the blood stream. Blood substitutes are used to replace hemoglobin in severe hemorrhage and also to perfuse isolated organs. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| perfluorotributylamine (CHEBI:38854) has functional parent tributylamine (CHEBI:38905) |
| perfluorotributylamine (CHEBI:38854) has role blood substitute (CHEBI:38849) |
| perfluorotributylamine (CHEBI:38854) has role greenhouse gas (CHEBI:76413) |
| perfluorotributylamine (CHEBI:38854) has role solvent (CHEBI:46787) |
| perfluorotributylamine (CHEBI:38854) is a organofluorine compound (CHEBI:37143) |
| IUPAC Name |
|---|
| 1,1,2,2,3,3,4,4,4-nonafluoro-N,N-bis(nonafluorobutyl)butan-1-amine |
| Synonyms | Source |
|---|---|
| FTBA | ChEBI |
| Heptacosafluorotributylamine | ChemIDplus |
| N,N,N-Tris(1,1,2,2,3,3,4,4,4-nonafluorobutyl)amine | NIST Chemistry WebBook |
| Tris(nonafluorobutyl)amine | ChemIDplus |
| Tris(perfluorobutyl)amine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Perfluorotributylamine | Wikipedia |
| Citations |
|---|