EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:38850 - perfluorotripropylamine
| Formula | C9F21N |
| Net Charge | 0 |
| Average Mass | 521.064 |
| Monoisotopic Mass | 520.96954 |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)N(C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9F21N/c10-1(11,4(16,17)18)7(25,26)31(8(27,28)2(12,13)5(19,20)21)9(29,30)3(14,15)6(22,23)24 |
| InChIKey | JAJLKEVKNDUJBG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | alkylating agent Highly reactive chemical that introduces alkyl radicals into biologically active molecules and thereby prevents their proper functioning. It could be used as an antineoplastic agent, but it might be very toxic, with carcinogenic, mutagenic, teratogenic, and immunosuppressant actions. It could also be used as a component of poison gases. |
| Application: | blood substitute A substance that can carry oxygen to and carbon dioxide away from the tissues when introduced into the blood stream. Blood substitutes are used to replace hemoglobin in severe hemorrhage and also to perfuse isolated organs. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| perfluorotripropylamine (CHEBI:38850) has functional parent tripropylamine (CHEBI:38880) |
| perfluorotripropylamine (CHEBI:38850) has role blood substitute (CHEBI:38849) |
| perfluorotripropylamine (CHEBI:38850) is a nitrogen mustard (CHEBI:37598) |
| perfluorotripropylamine (CHEBI:38850) is a organic molecular entity (CHEBI:50860) |
| perfluorotripropylamine (CHEBI:38850) is a organofluorine compound (CHEBI:37143) |
| IUPAC Name |
|---|
| 1,1,2,2,3,3,3-heptafluoro-N,N-bis(heptafluoropropyl)propan-1-amine |
| INN | Source |
|---|---|
| perfluamina | WHO MedNet |
| Synonyms | Source |
|---|---|
| 1,1,2,2,3,3,3-heptafluoro-N,N-bis(heptafluoropropyl)-1-propanamine | NIST Chemistry WebBook |
| Fluosol da perfluorotripropylamine | ChEMBL |
| FTPA | ChEBI |
| F-tripropylamine | ChEBI |
| heneicosafluorotripropylamine | NIST Chemistry WebBook |
| heptafluoro-N,N-bis(heptafluoropropyl)-1-propanamine | ChemIDplus |