EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9F21N |
| Net Charge | 0 |
| Average Mass | 521.064 |
| Monoisotopic Mass | 520.96954 |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)N(C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9F21N/c10-1(11,4(16,17)18)7(25,26)31(8(27,28)2(12,13)5(19,20)21)9(29,30)3(14,15)6(22,23)24 |
| InChIKey | JAJLKEVKNDUJBG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | blood substitute A substance that can carry oxygen to and carbon dioxide away from the tissues when introduced into the blood stream. Blood substitutes are used to replace hemoglobin in severe hemorrhage and also to perfuse isolated organs. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| perfluorotripropylamine (CHEBI:38850) has functional parent tripropylamine (CHEBI:38880) |
| perfluorotripropylamine (CHEBI:38850) has role blood substitute (CHEBI:38849) |
| perfluorotripropylamine (CHEBI:38850) is a organofluorine compound (CHEBI:37143) |
| IUPAC Name |
|---|
| 1,1,2,2,3,3,3-heptafluoro-N,N-bis(heptafluoropropyl)propan-1-amine |
| Synonyms | Source |
|---|---|
| FTPA | ChEBI |
| F-tripropylamine | ChEBI |
| Perfluamine | ChemIDplus |
| heptafluoro-N,N-bis(heptafluoropropyl)-1-propanamine | ChemIDplus |
| perfluorotripropylamine | ChemIDplus |
| 1,1,2,2,3,3,3-heptafluoro-N,N-bis(heptafluoropropyl)-1-propanamine | NIST Chemistry WebBook |