EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H20N3O3PS |
| Net Charge | 0 |
| Average Mass | 305.340 |
| Monoisotopic Mass | 305.09630 |
| SMILES | CCN(CC)c1nc(C)cc(OP(=S)(OC)OC)n1 |
| InChI | InChI=1S/C11H20N3O3PS/c1-6-14(7-2)11-12-9(3)8-10(13-11)17-18(19,15-4)16-5/h8H,6-7H2,1-5H3 |
| InChIKey | QHOQHJPRIBSPCY-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pirimiphos-methyl (CHEBI:38843) has functional parent 2-diethylamino-6-methylpyrimidin-4(1H)-one (CHEBI:38844) |
| pirimiphos-methyl (CHEBI:38843) has role acaricide (CHEBI:22153) |
| pirimiphos-methyl (CHEBI:38843) has role agrochemical (CHEBI:33286) |
| pirimiphos-methyl (CHEBI:38843) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| pirimiphos-methyl (CHEBI:38843) has role environmental contaminant (CHEBI:78298) |
| pirimiphos-methyl (CHEBI:38843) has role insecticide (CHEBI:24852) |
| pirimiphos-methyl (CHEBI:38843) is a aminopyrimidine (CHEBI:38338) |
| pirimiphos-methyl (CHEBI:38843) is a organic thiophosphate (CHEBI:37512) |
| IUPAC Name |
|---|
| O-[2-(diethylamino)-6-methylpyrimidin-4-yl] O,O-dimethyl phosphorothioate |
| Synonyms | Source |
|---|---|
| O-[2-(diethylamino)-6-methylpyrimidin-4-yl] O,O-dimethyl thiophosphate | IUPAC |
| Pirimifosmethyl | ChemIDplus |
| Pirimiphos methyl | NIST Chemistry WebBook |
| Pirimiphosmethyl | KEGG COMPOUND |
| Pyrimiphos methyl | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 532 | PPDB |
| C18403 | KEGG COMPOUND |
| Pirimiphos-methyl | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:755726 | Reaxys |
| CAS:29232-93-7 | ChemIDplus |
| CAS:29232-93-7 | NIST Chemistry WebBook |
| CAS:29232-93-7 | KEGG COMPOUND |
| Citations |
|---|