EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:3884 - corilagin
| Formula | C27H22O18 |
| Net Charge | 0 |
| Average Mass | 634.455 |
| Monoisotopic Mass | 634.08061 |
| SMILES | O=C(O[C@@H]1O[C@@H]2COC(=O)c3cc(O)c(O)c(O)c3-c3c(cc(O)c(O)c3O)C(=O)O[C@H]([C@H]1O)[C@@H]2O)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C27H22O18/c28-9-1-6(2-10(29)16(9)32)24(39)45-27-22(38)23-19(35)13(43-27)5-42-25(40)7-3-11(30)17(33)20(36)14(7)15-8(26(41)44-23)4-12(31)18(34)21(15)37/h1-4,13,19,22-23,27-38H,5H2/t13-,19-,22-,23+,27+/m1/s1 |
| InChIKey | TUSDEZXZIZRFGC-XIGLUPEJSA-N |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). |
| Applications: | non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| corilagin (CHEBI:3884) has role antihypertensive agent (CHEBI:35674) |
| corilagin (CHEBI:3884) has role antioxidant (CHEBI:22586) |
| corilagin (CHEBI:3884) has role EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor (CHEBI:35457) |
| corilagin (CHEBI:3884) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| corilagin (CHEBI:3884) is a ellagitannin (CHEBI:23909) |
| corilagin (CHEBI:3884) is a gallate ester (CHEBI:37576) |
| IUPAC Name |
|---|
| 3-O,6-O-[carbonyl(4,4',5,5',6,6'-hexahydroxybiphenyl-2,2'-diyl)carbonyl]-1-O-(3,4,5-trihydroxybenzoyl)-β-D-glucopyranose |
| Synonyms | Source |
|---|---|
| 1-O-galloyl-3,6-hexahydroxydiphenic acid-β-D-glucopyranose | ChEBI |
| (beta-1-O-galloyl-3,6-(R)-hexahydroxydiphenoyl-d-glucose) | ChEBI |
| Corilagin | KEGG COMPOUND |
| gallotannin | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:76352 | Beilstein |
| CAS:23094-69-1 | KEGG COMPOUND |
| CAS:23094-69-1 | ChemIDplus |
| Citations |
|---|