EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:3884 - corilagin
| Formula | C27H22O18 |
| Net Charge | 0 |
| Average Mass | 634.455 |
| Monoisotopic Mass | 634.08061 |
| SMILES | O=C(O[C@@H]1O[C@@H]2COC(=O)c3cc(O)c(O)c(O)c3-c3c(cc(O)c(O)c3O)C(=O)O[C@H]([C@H]1O)[C@@H]2O)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C27H22O18/c28-9-1-6(2-10(29)16(9)32)24(39)45-27-22(38)23-19(35)13(43-27)5-42-25(40)7-3-11(30)17(33)20(36)14(7)15-8(26(41)44-23)4-12(31)18(34)21(15)37/h1-4,13,19,22-23,27-38H,5H2/t13-,19-,22-,23+,27+/m1/s1 |
| InChIKey | TUSDEZXZIZRFGC-XIGLUPEJSA-N |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). |
| Applications: | EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| corilagin (CHEBI:3884) has role antihypertensive agent (CHEBI:35674) |
| corilagin (CHEBI:3884) has role antioxidant (CHEBI:22586) |
| corilagin (CHEBI:3884) has role EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor (CHEBI:35457) |
| corilagin (CHEBI:3884) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| corilagin (CHEBI:3884) is a ellagitannin (CHEBI:23909) |
| corilagin (CHEBI:3884) is a gallate ester (CHEBI:37576) |
| IUPAC Name |
|---|
| 3-O,6-O-[carbonyl(4,4',5,5',6,6'-hexahydroxybiphenyl-2,2'-diyl)carbonyl]-1-O-(3,4,5-trihydroxybenzoyl)-β-D-glucopyranose |
| Synonyms | Source |
|---|---|
| Corilagin | KEGG COMPOUND |
| (beta-1-O-galloyl-3,6-(R)-hexahydroxydiphenoyl-d-glucose) | ChEBI |
| gallotannin | ChEBI |
| 1-O-galloyl-3,6-hexahydroxydiphenic acid-β-D-glucopyranose | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:76352 | Beilstein |
| CAS:23094-69-1 | KEGG COMPOUND |
| CAS:23094-69-1 | ChemIDplus |
| Citations |
|---|