EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H4N2S3 |
| Net Charge | 0 |
| Average Mass | 236.346 |
| Monoisotopic Mass | 235.95366 |
| SMILES | S=c1sc2nc3ccccc3nc2s1 |
| InChI | InChI=1S/C9H4N2S3/c12-9-13-7-8(14-9)11-6-4-2-1-3-5(6)10-7/h1-4H |
| InChIKey | ILERPRJWJPJZDN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thioquinox (CHEBI:38822) is a dithioloquinoxaline (CHEBI:38919) |
| thioquinox (CHEBI:38822) is a quinoxaline acaricide (CHEBI:38820) |
| thioquinox (CHEBI:38822) is a quinoxaline antifungal agent (CHEBI:38819) |
| IUPAC Name |
|---|
| [1,3]dithiolo[4,5-b]quinoxaline-2-thione |
| Synonyms | Source |
|---|---|
| thioquinox | ChemIDplus |
| 2,3-quinoxalinedithiol cyclic-trithiocarbonate | ChemIDplus |
| trithiocarbonic acid, cyclic ester with 2,3-quinoxalinedithiol | ChemIDplus |
| quinothionate | ChemIDplus |