EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H18ClNO5 |
| Net Charge | 0 |
| Average Mass | 363.797 |
| Monoisotopic Mass | 363.08735 |
| SMILES | CCON=C(OC(=O)c1ccccc1)c1c(OC)ccc(Cl)c1OC |
| InChI | InChI=1S/C18H18ClNO5/c1-4-24-20-17(25-18(21)12-8-6-5-7-9-12)15-14(22-2)11-10-13(19)16(15)23-3/h5-11H,4H2,1-3H3 |
| InChIKey | BZMIHNKNQJJVRO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benzoximate (CHEBI:38813) has functional parent benzoic anhydride (CHEBI:38815) |
| benzoximate (CHEBI:38813) is a aromatic ether (CHEBI:35618) |
| benzoximate (CHEBI:38813) is a monochlorobenzenes (CHEBI:83403) |
| benzoximate (CHEBI:38813) is a organochlorine acaricide (CHEBI:38657) |
| IUPAC Name |
|---|
| (3-chloro-2,6-dimethoxyphenyl)(ethoxyimino)methyl benzoate |
| Synonyms | Source |
|---|---|
| 3-chloro-α-ethoxyimino-2,6-dimethoxybenzyl benzoate | ChemIDplus |
| benzoic 3-chloro-N-ethoxy-2,6-dimethoxybenzimidic anhydride | ChemIDplus |
| benzoximate | ChemIDplus |
| ethyl O-benzoyl 3-chloro-2,6-dimethoxy-benzohydroximate | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2783319 | Beilstein |
| CAS:29104-30-1 | ChemIDplus |
| CAS:29104-30-1 | KEGG COMPOUND |