EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:38803 - perflubron
| Formula | C8BrF17 |
| Net Charge | 0 |
| Average Mass | 498.958 |
| Monoisotopic Mass | 497.89119 |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Br |
| InChI | InChI=1S/C8BrF17/c9-7(22,23)5(18,19)3(14,15)1(10,11)2(12,13)4(16,17)6(20,21)8(24,25)26 |
| InChIKey | WTWWXOGTJWMJHI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | radioopaque medium A substance having the property of absorbing, and therefore being opaque to, electromagnetic radiation, particularly X-rays. blood substitute A substance that can carry oxygen to and carbon dioxide away from the tissues when introduced into the blood stream. Blood substitutes are used to replace hemoglobin in severe hemorrhage and also to perfuse isolated organs. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| perflubron (CHEBI:38803) has parent hydride octane (CHEBI:17590) |
| perflubron (CHEBI:38803) has role blood substitute (CHEBI:38849) |
| perflubron (CHEBI:38803) has role radioopaque medium (CHEBI:37338) |
| perflubron (CHEBI:38803) is a haloalkane (CHEBI:24469) |
| perflubron (CHEBI:38803) is a organobromine compound (CHEBI:37141) |
| perflubron (CHEBI:38803) is a perfluorinated compound (CHEBI:134091) |
| IUPAC Name |
|---|
| 1-bromo-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane |
| Synonyms | Source |
|---|---|
| LiquiVent | ChemIDplus |
| perfluorooctyl bromide | ChemIDplus |
| Imagent GI | ChemIDplus |
| PFOB | ChEBI |
| 1-bromoperfluorooctane | NIST Chemistry WebBook |
| 1-bromoheptadecafluorooctane | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| WO2007139827 | Patent |
| WO2007105978 | Patent |
| WO2006059063 | Patent |
| WO0234297 | Patent |
| WO9103267 | Patent |
| RU2162692 | Patent |
| US5928663 | Patent |
| CA2156922 | Patent |
| EP0549387 | Patent |
| US3975512 | Patent |
| GB1381879 | Patent |
| 2102 | DrugCentral |