EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H22F7IN2O4S |
| Net Charge | 0 |
| Average Mass | 682.396 |
| Monoisotopic Mass | 682.02332 |
| SMILES | Cc1cc(C(F)(C(F)(F)F)C(F)(F)F)ccc1NC(=O)c1cccc(I)c1C(=O)NC(C)(C)CS(C)(=O)=O |
| InChI | InChI=1S/C23H22F7IN2O4S/c1-12-10-13(21(24,22(25,26)27)23(28,29)30)8-9-16(12)32-18(34)14-6-5-7-15(31)17(14)19(35)33-20(2,3)11-38(4,36)37/h5-10H,11H2,1-4H3,(H,32,34)(H,33,35) |
| InChIKey | ZGNITFSDLCMLGI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | |
| Applications: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| flubendiamide (CHEBI:38798) has functional parent phthalamide (CHEBI:38799) |
| flubendiamide (CHEBI:38798) has role ryanodine receptor modulator (CHEBI:38809) |
| flubendiamide (CHEBI:38798) is a organofluorine insecticide (CHEBI:38804) |
| IUPAC Name |
|---|
| N2-[1,1-dimethyl-2-(methylsulfonyl)ethyl]-3-iodo-N1-{2-methyl-4-[1,2,2,2-tetrafluoro-1-(trifluoromethyl)ethyl]phenyl}benzene-1,2-dicarboxamide |
| Synonyms | Source |
|---|---|
| N2-[1,1-dimethyl-2-(methylsulfonyl)ethyl]-3-iodo-N1-{2-methyl-4-[1,2,2,2-tetrafluoro-1-(trifluoromethyl)ethyl]phenyl}phthalamide | IUPAC |
| flubendiamide | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:272451-65-7 | ChemIDplus |
| CAS:272451-65-7 | KEGG COMPOUND |