EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H12NO4PS2 |
| Net Charge | 0 |
| Average Mass | 317.328 |
| Monoisotopic Mass | 316.99454 |
| SMILES | COP(=S)(OC)SCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C11H12NO4PS2/c1-15-17(18,16-2)19-7-12-10(13)8-5-3-4-6-9(8)11(12)14/h3-6H,7H2,1-2H3 |
| InChIKey | LMNZTLDVJIUSHT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. |
| Applications: | acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). agrochemical An agrochemical is a substance that is used in agriculture or horticulture. insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phosmet (CHEBI:38786) has functional parent N-(hydroxymethyl)phthalimide (CHEBI:38816) |
| phosmet (CHEBI:38786) has role acaricide (CHEBI:22153) |
| phosmet (CHEBI:38786) has role agrochemical (CHEBI:33286) |
| phosmet (CHEBI:38786) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| phosmet (CHEBI:38786) is a organic thiophosphate (CHEBI:37512) |
| phosmet (CHEBI:38786) is a organothiophosphate insecticide (CHEBI:25715) |
| phosmet (CHEBI:38786) is a phthalimides (CHEBI:82851) |
| IUPAC Name |
|---|
| S-[(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)methyl] O,O-dimethyl phosphorodithioate |
| Synonyms | Source |
|---|---|
| Decemthion | ChemIDplus |
| S-[(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)methyl] O,O-dimethyl dithiophosphate | IUPAC |
| Fosmet | ChemIDplus |
| O,O-Dimethyl phthalimidomethyl phosphorodithioate | ChemIDplus |
| O,O-Dimethyl S-(phthalimidomethyl) dithiophosphate | ChemIDplus |
| O,O-Dimethyl S-phthalimidomethyl phosphorodithioate | ChemIDplus |