EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H14N2O4 |
| Net Charge | 0 |
| Average Mass | 202.210 |
| Monoisotopic Mass | 202.09536 |
| SMILES | N[C@@H](CCC(=O)NC1(O)CC1)C(=O)O |
| InChI | InChI=1S/C8H14N2O4/c9-5(7(12)13)1-2-6(11)10-8(14)3-4-8/h5,14H,1-4,9H2,(H,10,11)(H,12,13)/t5-/m0/s1 |
| InChIKey | OEEZRBUCLFMTLD-YFKPBYRVSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. mycotoxin Poisonous substance produced by fungi. EC 1.2.1.3 [aldehyde dehydrogenase (NAD(+))] inhibitor An EC 1.2.1.* (oxidoreductase acting on donor aldehyde/oxo group with NAD+ or NADP+ as acceptor) inhibitor that interferes with the action of aldehyde dehydrogenase (NAD+), EC 1.2.1.3. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| coprine (CHEBI:3875) has role EC 1.2.1.3 [aldehyde dehydrogenase (NAD+)] inhibitor (CHEBI:35487) |
| coprine (CHEBI:3875) has role metabolite (CHEBI:25212) |
| coprine (CHEBI:3875) has role mycotoxin (CHEBI:25442) |
| coprine (CHEBI:3875) is a L-glutamine derivative (CHEBI:24317) |
| coprine (CHEBI:3875) is a cyclopropanes (CHEBI:51454) |
| coprine (CHEBI:3875) is a dicarboxylic acid monoamide (CHEBI:35735) |
| coprine (CHEBI:3875) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| IUPAC Name |
|---|
| N-(1-hydroxycyclopropyl)-L-glutamine |
| Synonyms | Source |
|---|---|
| (2S)-2,5-diamino-5-oxopentanoic acid | IUPAC |
| N5-(1-hydroxycyclopropyl)-L-glutamine | ChemIDplus |
| L-coprine | HMDB |
| Manual Xrefs | Databases |
|---|---|
| C00001349 | KNApSAcK |
| C08271 | KEGG COMPOUND |
| HMDB0034266 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2053887 | Reaxys |
| CAS:58919-61-2 | ChemIDplus |
| CAS:58919-61-2 | KEGG COMPOUND |
| Citations |
|---|