EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:38729 - naled
| Formula | C4H7Br2Cl2O4P |
| Net Charge | 0 |
| Average Mass | 380.784 |
| Monoisotopic Mass | 377.78257 |
| SMILES | COP(=O)(OC)OC(Br)C(Cl)(Cl)Br |
| InChI | InChI=1S/C4H7Br2Cl2O4P/c1-10-13(9,11-2)12-3(5)4(6,7)8/h3H,1-2H3 |
| InChIKey | BUYMVQAILCEWRR-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. EC 3.1.1.8 (cholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of cholinesterase (EC 3.1.1.8). antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Applications: | acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). agrochemical An agrochemical is a substance that is used in agriculture or horticulture. insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| naled (CHEBI:38729) has role acaricide (CHEBI:22153) |
| naled (CHEBI:38729) has role agrochemical (CHEBI:33286) |
| naled (CHEBI:38729) has role antibacterial agent (CHEBI:33282) |
| naled (CHEBI:38729) has role antifungal agent (CHEBI:35718) |
| naled (CHEBI:38729) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| naled (CHEBI:38729) has role EC 3.1.1.8 (cholinesterase) inhibitor (CHEBI:37733) |
| naled (CHEBI:38729) is a dialkyl phosphate (CHEBI:16648) |
| naled (CHEBI:38729) is a organobromine compound (CHEBI:37141) |
| naled (CHEBI:38729) is a organochlorine compound (CHEBI:36683) |
| naled (CHEBI:38729) is a organophosphate insecticide (CHEBI:25708) |
| IUPAC Name |
|---|
| 1,2-dibromo-2,2-dichloroethyl dimethyl phosphate |
| Synonyms | Source |
|---|---|
| dimethyl-1,2-dibromo-2,2-dichloroethyl phosphate | Patent |
| O-(1,2-dibromo-2,2-dichloroethyl)-O,O-dimethyl phosphate | NIST Chemistry WebBook |
| O,O-dimethyl O-2,2-dichloro-1,2-dibromoethyl phosphate | ChemIDplus |
| phosphoric acid, 1,2-dibromo-2,2-dichloroethyl dimethyl ester | ChemIDplus |
| Brand Names | Source |
|---|---|
| Bromex | ChemIDplus |
| Dibrom | ChemIDplus |
| Ortho-Dibrom | NIST Chemistry WebBook |