EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H7Br2Cl2O4P |
| Net Charge | 0 |
| Average Mass | 380.784 |
| Monoisotopic Mass | 377.78257 |
| SMILES | COP(=O)(OC)OC(Br)C(Cl)(Cl)Br |
| InChI | InChI=1S/C4H7Br2Cl2O4P/c1-10-13(9,11-2)12-3(5)4(6,7)8/h3H,1-2H3 |
| InChIKey | BUYMVQAILCEWRR-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. EC 3.1.1.8 (cholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of cholinesterase (EC 3.1.1.8). |
| Applications: | acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). agrochemical An agrochemical is a substance that is used in agriculture or horticulture. insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| naled (CHEBI:38729) has role acaricide (CHEBI:22153) |
| naled (CHEBI:38729) has role agrochemical (CHEBI:33286) |
| naled (CHEBI:38729) has role antibacterial agent (CHEBI:33282) |
| naled (CHEBI:38729) has role antifungal agent (CHEBI:35718) |
| naled (CHEBI:38729) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| naled (CHEBI:38729) has role EC 3.1.1.8 (cholinesterase) inhibitor (CHEBI:37733) |
| naled (CHEBI:38729) is a dialkyl phosphate (CHEBI:16648) |
| naled (CHEBI:38729) is a organobromine compound (CHEBI:37141) |
| naled (CHEBI:38729) is a organochlorine compound (CHEBI:36683) |
| naled (CHEBI:38729) is a organophosphate insecticide (CHEBI:25708) |
| IUPAC Name |
|---|
| 1,2-dibromo-2,2-dichloroethyl dimethyl phosphate |
| Synonyms | Source |
|---|---|
| dimethyl-1,2-dibromo-2,2-dichloroethyl phosphate | Patent |
| O-(1,2-dibromo-2,2-dichloroethyl)-O,O-dimethyl phosphate | NIST Chemistry WebBook |
| O,O-dimethyl O-2,2-dichloro-1,2-dibromoethyl phosphate | ChemIDplus |
| phosphoric acid, 1,2-dibromo-2,2-dichloroethyl dimethyl ester | ChemIDplus |
| Brand Names | Source |
|---|---|
| Bromex | ChemIDplus |
| Dibrom | ChemIDplus |
| Ortho-Dibrom | NIST Chemistry WebBook |