EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H14NO5P |
| Net Charge | 0 |
| Average Mass | 223.165 |
| Monoisotopic Mass | 223.06096 |
| SMILES | CNC(=O)/C=C(\C)OP(=O)(OC)OC |
| InChI | InChI=1S/C7H14NO5P/c1-6(5-7(9)8-2)13-14(10,11-3)12-4/h5H,1-4H3,(H,8,9)/b6-5+ |
| InChIKey | KRTSDMXIXPKRQR-AATRIKPKSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | EC 1.4.3.4 (monoamine oxidase) inhibitor An EC 1.4.3.* (oxidoreductase acting on donor CH-NH2 group, oxygen as acceptor) inhibitor that interferes with the action of monoamine oxidase (EC 1.4.3.4). EC 3.1.1.8 (cholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of cholinesterase (EC 3.1.1.8). EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. avicide A substance used to destroy bird pests (class Aves). acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| monocrotophos (CHEBI:38728) has role acaricide (CHEBI:22153) |
| monocrotophos (CHEBI:38728) has role agrochemical (CHEBI:33286) |
| monocrotophos (CHEBI:38728) has role avicide (CHEBI:33289) |
| monocrotophos (CHEBI:38728) has role EC 1.4.3.4 (monoamine oxidase) inhibitor (CHEBI:38623) |
| monocrotophos (CHEBI:38728) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| monocrotophos (CHEBI:38728) has role EC 3.1.1.8 (cholinesterase) inhibitor (CHEBI:37733) |
| monocrotophos (CHEBI:38728) is a alkenyl phosphate (CHEBI:37494) |
| monocrotophos (CHEBI:38728) is a dialkyl phosphate (CHEBI:16648) |
| monocrotophos (CHEBI:38728) is a monocarboxylic acid amide (CHEBI:29347) |
| monocrotophos (CHEBI:38728) is a organophosphate insecticide (CHEBI:25708) |
| IUPAC Name |
|---|
| dimethyl (1E)-1-methyl-3-(methylamino)-3-oxoprop-1-en-1-yl phosphate |
| Synonyms | Source |
|---|---|
| Azodrin | ChemIDplus |
| Phosphoric acid, dimethyl (E)-1-methyl-3-(methylamino)-3-oxo-1-propenyl ester | ChemIDplus |
| Dimethyl (E)-1-methyl-2-(methylcarbamoyl)vinyl phosphate | ChemIDplus |
| Dimethyl (E)-3-hydroxy-N-methylcrotonamide | ChemIDplus |
| (E)-monocrotophos | HMDB |
| Manual Xrefs | Databases |
|---|---|
| Monocrotophos | Wikipedia |
| HMDB0031805 | HMDB |
| C18663 | KEGG COMPOUND |
| 1111 | PPDB |
| Citations |
|---|