EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H14NO5P |
| Net Charge | 0 |
| Average Mass | 223.165 |
| Monoisotopic Mass | 223.06096 |
| SMILES | CNC(=O)/C=C(\C)OP(=O)(OC)OC |
| InChI | InChI=1S/C7H14NO5P/c1-6(5-7(9)8-2)13-14(10,11-3)12-4/h5H,1-4H3,(H,8,9)/b6-5+ |
| InChIKey | KRTSDMXIXPKRQR-AATRIKPKSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. EC 3.1.1.8 (cholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of cholinesterase (EC 3.1.1.8). EC 1.4.3.4 (monoamine oxidase) inhibitor An EC 1.4.3.* (oxidoreductase acting on donor CH-NH2 group, oxygen as acceptor) inhibitor that interferes with the action of monoamine oxidase (EC 1.4.3.4). |
| Applications: | avicide A substance used to destroy bird pests (class Aves). acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). agrochemical An agrochemical is a substance that is used in agriculture or horticulture. insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| monocrotophos (CHEBI:38728) has role acaricide (CHEBI:22153) |
| monocrotophos (CHEBI:38728) has role agrochemical (CHEBI:33286) |
| monocrotophos (CHEBI:38728) has role avicide (CHEBI:33289) |
| monocrotophos (CHEBI:38728) has role EC 1.4.3.4 (monoamine oxidase) inhibitor (CHEBI:38623) |
| monocrotophos (CHEBI:38728) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| monocrotophos (CHEBI:38728) has role EC 3.1.1.8 (cholinesterase) inhibitor (CHEBI:37733) |
| monocrotophos (CHEBI:38728) is a alkenyl phosphate (CHEBI:37494) |
| monocrotophos (CHEBI:38728) is a dialkyl phosphate (CHEBI:16648) |
| monocrotophos (CHEBI:38728) is a monocarboxylic acid amide (CHEBI:29347) |
| monocrotophos (CHEBI:38728) is a organophosphate insecticide (CHEBI:25708) |
| IUPAC Name |
|---|
| dimethyl (1E)-1-methyl-3-(methylamino)-3-oxoprop-1-en-1-yl phosphate |
| Synonyms | Source |
|---|---|
| Azodrin | ChemIDplus |
| Dimethyl (E)-1-methyl-2-(methylcarbamoyl)vinyl phosphate | ChemIDplus |
| Dimethyl (E)-3-hydroxy-N-methylcrotonamide | ChemIDplus |
| (E)-monocrotophos | HMDB |
| Phosphoric acid, dimethyl (E)-1-methyl-3-(methylamino)-3-oxo-1-propenyl ester | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1111 | PPDB |
| C18663 | KEGG COMPOUND |
| HMDB0031805 | HMDB |
| Monocrotophos | Wikipedia |
| Citations |
|---|