EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H13O6P |
| Net Charge | 0 |
| Average Mass | 224.149 |
| Monoisotopic Mass | 224.04497 |
| SMILES | COC(=O)C=C(C)OP(=O)(OC)OC |
| InChI | InChI=1S/C7H13O6P/c1-6(5-7(8)10-2)13-14(9,11-3)12-4/h5H,1-4H3 |
| InChIKey | GEPDYQSQVLXLEU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. avicide A substance used to destroy bird pests (class Aves). acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mevinphos (CHEBI:38725) has functional parent methyl 3-hydroxybut-2-enoate (CHEBI:38726) |
| mevinphos (CHEBI:38725) has role acaricide (CHEBI:22153) |
| mevinphos (CHEBI:38725) has role agrochemical (CHEBI:33286) |
| mevinphos (CHEBI:38725) has role avicide (CHEBI:33289) |
| mevinphos (CHEBI:38725) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| mevinphos (CHEBI:38725) is a dialkyl phosphate (CHEBI:16648) |
| mevinphos (CHEBI:38725) is a organophosphate insecticide (CHEBI:25708) |
| IUPAC Name |
|---|
| methyl 3-[(dimethoxyphosphoryl)oxy]but-2-enoate |
| Synonyms | Source |
|---|---|
| 1-Methoxycarbonyl-1-propen-2-yl dimethyl phosphate | ChemIDplus |
| 2-Methoxycarbonyl-1-methylvinyl dimethyl phosphate | ChemIDplus |
| Methyl 3-((dimethoxyphosphinyl)oxy)-2-butenoate | ChemIDplus |
| Methyl 3-hydroxycrotonate dimethyl phosphate ester | ChemIDplus |
| O,O-Dimethyl O-(1-methyl-2-carboxyvinyl) phosphate | ChemIDplus |
| Phosdrin | ChemIDplus |