EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C42H32O9 |
| Net Charge | 0 |
| Average Mass | 680.709 |
| Monoisotopic Mass | 680.20463 |
| SMILES | [H][C@]12C(c3ccc(O)cc3)=C(c3cc(O)cc(O)c3)[C@H](c3ccc(O)cc3)c3c(O)cc(O)cc3[C@]1([H])[C@H](c1ccc(O)cc1)c1c(O)cc(O)cc12 |
| InChI | InChI=1S/C42H32O9/c43-24-7-1-20(2-8-24)35-38(23-13-27(46)15-28(47)14-23)36(21-3-9-25(44)10-4-21)41-32-17-30(49)19-34(51)40(32)37(22-5-11-26(45)12-6-22)42(41)31-16-29(48)18-33(50)39(31)35/h1-19,35,37,41-51H/t35-,37+,41-,42+/m0/s1 |
| InChIKey | WJBCPQVBWGTJNA-GUOLYAGMSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Copalliferol B (CHEBI:3872) is a diarylheptanoid (CHEBI:78802) |
| Synonym | Source |
|---|---|
| Copalliferol B | KEGG COMPOUND |