EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H5O4S |
| Net Charge | -1 |
| Average Mass | 149.147 |
| Monoisotopic Mass | 148.99140 |
| SMILES | O=C([O-])CC(S)C(=O)O |
| InChI | InChI=1S/C4H6O4S/c5-3(6)1-2(9)4(7)8/h2,9H,1H2,(H,5,6)(H,7,8)/p-1 |
| InChIKey | NJRXVEJTAYWCQJ-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-carboxy-3-mercaptopropanoate (CHEBI:38707) is a thiomalate(1−) (CHEBI:38708) |
| 3-carboxy-3-mercaptopropanoate (CHEBI:38707) is tautomer of 1,2-dicarboxyethanethiolate (CHEBI:38709) |
| Incoming Relation(s) |
| 1,2-dicarboxyethanethiolate (CHEBI:38709) is tautomer of 3-carboxy-3-mercaptopropanoate (CHEBI:38707) |
| IUPAC Name |
|---|
| 3-carboxy-3-sulfanylpropanoate |
| Registry Numbers | Sources |
|---|---|
| Gmelin:2186863 | Gmelin |
| Beilstein:8141616 | Beilstein |