EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H12ClO4P |
| Net Charge | 0 |
| Average Mass | 250.618 |
| Monoisotopic Mass | 250.01617 |
| SMILES | COP(=O)(OC)OC1=C(Cl)C2C=CCC12 |
| InChI | InChI=1S/C9H12ClO4P/c1-12-15(11,13-2)14-9-7-5-3-4-6(7)8(9)10/h3-4,6-7H,5H2,1-2H3 |
| InChIKey | GBAWQJNHVWMTLU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. |
| Applications: | acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). agrochemical An agrochemical is a substance that is used in agriculture or horticulture. insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| heptenophos (CHEBI:38693) has parent hydride bicyclo[3.2.0]hepta-2,6-diene (CHEBI:38694) |
| heptenophos (CHEBI:38693) has role acaricide (CHEBI:22153) |
| heptenophos (CHEBI:38693) has role agrochemical (CHEBI:33286) |
| heptenophos (CHEBI:38693) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| heptenophos (CHEBI:38693) is a organochlorine compound (CHEBI:36683) |
| heptenophos (CHEBI:38693) is a organophosphate insecticide (CHEBI:25708) |
| heptenophos (CHEBI:38693) is a trialkyl phosphate (CHEBI:37562) |
| IUPAC Name |
|---|
| 7-chlorobicyclo[3.2.0]hepta-2,6-dien-6-yl dimethyl phosphate |
| Synonyms | Source |
|---|---|
| Hostaquick | ChemIDplus |
| O,O'-Dimethyl-O-(6-chlorobicyclo(3.2.0)heptadiene-1,5-yl)phosphate | ChemIDplus |
| Ragadan | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1978448 | Beilstein |
| CAS:23560-59-0 | NIST Chemistry WebBook |
| CAS:23560-59-0 | ChemIDplus |
| CAS:23560-59-0 | KEGG COMPOUND |