EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:38680 - fenamiphos
| Formula | C13H22NO3PS |
| Net Charge | 0 |
| Average Mass | 303.364 |
| Monoisotopic Mass | 303.10580 |
| SMILES | CCOP(=O)(NC(C)C)Oc1ccc(SC)c(C)c1 |
| InChI | InChI=1S/C13H22NO3PS/c1-6-16-18(15,14-10(2)3)17-12-7-8-13(19-5)11(4)9-12/h7-10H,6H2,1-5H3,(H,14,15) |
| InChIKey | ZCJPOPBZHLUFHF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. nematicide A substance used to destroy pests of the phylum Nematoda (roundworms). pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fenamiphos (CHEBI:38680) has functional parent 4-(methylsulfanyl)-m-cresol (CHEBI:38681) |
| fenamiphos (CHEBI:38680) has role acaricide (CHEBI:22153) |
| fenamiphos (CHEBI:38680) has role agrochemical (CHEBI:33286) |
| fenamiphos (CHEBI:38680) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| fenamiphos (CHEBI:38680) is a organophosphate insecticide (CHEBI:25708) |
| fenamiphos (CHEBI:38680) is a organophosphate nematicide (CHEBI:39094) |
| fenamiphos (CHEBI:38680) is a phosphoramidate ester (CHEBI:27577) |
| IUPAC Name |
|---|
| ethyl 3-methyl-4-(methylsulfanyl)phenyl N-(propan-2-yl)phosphoramidate |
| Synonyms | Source |
|---|---|
| methaphenamiphos | ChemIDplus |
| ethyl 3-methyl-4-(methylsulfanyl)phenyl (1-methylethyl)amidophosphate | IUPAC |
| phenamiphos | ChemIDplus |
| isopropylamino-O-ethyl-(4-methylmercapto-3-methylphenyl)phosphate | ChemIDplus |
| ethyl 4-(methylthio)-m-tolyl isopropylphosphoramidate | ChemIDplus |
| ethyl 3-methyl-4-(methylthio)phenyl isopropylphosphoramidate | ChemIDplus |
| UniProt Name | Source |
|---|---|
| fenamiphos | UniProt |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4752893 | Beilstein |
| CAS:22224-92-6 | ChemIDplus |
| CAS:22224-92-6 | NIST Chemistry WebBook |
| CAS:22224-92-6 | KEGG COMPOUND |