EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16NO5PS2 |
| Net Charge | 0 |
| Average Mass | 325.348 |
| Monoisotopic Mass | 325.02075 |
| SMILES | COP(=S)(OC)Oc1ccc(S(=O)(=O)N(C)C)cc1 |
| InChI | InChI=1S/C10H16NO5PS2/c1-11(2)19(12,13)10-7-5-9(6-8-10)16-17(18,14-3)15-4/h5-8H,1-4H3 |
| InChIKey | JISACBWYRJHSMG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. anthelminthic drug Substance intended to kill parasitic worms (helminths). insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| famphur (CHEBI:38677) has functional parent 4-hydroxy-N,N-dimethylbenzenesulfonamide (CHEBI:38678) |
| famphur (CHEBI:38677) has role agrochemical (CHEBI:33286) |
| famphur (CHEBI:38677) has role anthelminthic drug (CHEBI:35443) |
| famphur (CHEBI:38677) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| famphur (CHEBI:38677) is a organic thiophosphate (CHEBI:37512) |
| famphur (CHEBI:38677) is a organothiophosphate insecticide (CHEBI:25715) |
| IUPAC Name |
|---|
| O-[4-(dimethylsulfamoyl)phenyl] O,O-dimethyl phosphorothioate |
| Synonyms | Source |
|---|---|
| O-[4-(dimethylsulfamoyl)phenyl] O,O-dimethyl thiophosphate | IUPAC |
| Famophos | NIST Chemistry WebBook |
| Famophos | KEGG COMPOUND |
| Phosphorothioic acid, O-(4-((dimethylamino)sulfonyl)phenyl) O,O-dimethyl ester | ChemIDplus |