EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H22O4P2S4 |
| Net Charge | 0 |
| Average Mass | 384.487 |
| Monoisotopic Mass | 383.98762 |
| SMILES | CCOP(=S)(OCC)SCSP(=S)(OCC)OCC |
| InChI | InChI=1S/C9H22O4P2S4/c1-5-10-14(16,11-6-2)18-9-19-15(17,12-7-3)13-8-4/h5-9H2,1-4H3 |
| InChIKey | RIZMRRKBZQXFOY-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Role: | EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethion (CHEBI:38663) has role acaricide (CHEBI:22153) |
| ethion (CHEBI:38663) has role agrochemical (CHEBI:33286) |
| ethion (CHEBI:38663) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| ethion (CHEBI:38663) has role environmental contaminant (CHEBI:78298) |
| ethion (CHEBI:38663) has role insecticide (CHEBI:24852) |
| ethion (CHEBI:38663) is a organic thiophosphate (CHEBI:37512) |
| IUPAC Name |
|---|
| O,O,O',O'-tetraethyl S,S'-methanediyl bis(phosphorodithioate) |
| Synonyms | Source |
|---|---|
| Bis(S-(diethoxyphosphinothioyl)mercapto)methane | ChemIDplus |
| O,O,O',O'-tetraethyl S,S'-methanediyl bis(dithiophosphate) | IUPAC |
| O,O,O',O'-Tetraethyl S,S'-methylenebis(phosphorodithioate) | ChemIDplus |
| S,S'-Methylene bis(O,O-diethyl phosphorodithioate) | ChemIDplus |
| Citations |
|---|