EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | CH4N2O2 |
| Net Charge | 0 |
| Average Mass | 76.055 |
| Monoisotopic Mass | 76.02728 |
| SMILES | NNC(=O)O |
| InChI | InChI=1S/CH4N2O2/c2-3-1(4)5/h3H,2H2,(H,4,5) |
| InChIKey | OWIUPIRUAQMTTK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| carbazic acid (CHEBI:38662) has parent hydride hydrazine (CHEBI:15571) |
| carbazic acid (CHEBI:38662) is a monocarboxylic acid (CHEBI:25384) |
| carbazic acid (CHEBI:38662) is a one-carbon compound (CHEBI:64708) |
| Incoming Relation(s) |
| bifenazate (CHEBI:38660) has functional parent carbazic acid (CHEBI:38662) |
| carbonyl dihydrazine (CHEBI:61308) has functional parent carbazic acid (CHEBI:38662) |
| N-[[(cyclohexylamino)-sulfanylidenemethyl]amino]carbamic acid tert-butyl ester (CHEBI:108981) has functional parent carbazic acid (CHEBI:38662) |
| IUPAC Name |
|---|
| hydrazinecarboxylic acid |
| Synonyms | Source |
|---|---|
| carbazic acid | ChemIDplus |
| α-azaglycine | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Gmelin:130427 | Gmelin |
| Beilstein:1699883 | Beilstein |
| CAS:471-31-8 | ChemIDplus |