EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H16NO5P |
| Net Charge | 0 |
| Average Mass | 237.192 |
| Monoisotopic Mass | 237.07661 |
| SMILES | COP(=O)(OC)O/C(C)=C/C(=O)N(C)C |
| InChI | InChI=1S/C8H16NO5P/c1-7(6-8(10)9(2)3)14-15(11,12-4)13-5/h6H,1-5H3/b7-6+ |
| InChIKey | VEENJGZXVHKXNB-VOTSOKGWSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. |
| Applications: | acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). agrochemical An agrochemical is a substance that is used in agriculture or horticulture. avicide A substance used to destroy bird pests (class Aves). insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dicrotophos (CHEBI:38658) has role acaricide (CHEBI:22153) |
| dicrotophos (CHEBI:38658) has role agrochemical (CHEBI:33286) |
| dicrotophos (CHEBI:38658) has role avicide (CHEBI:33289) |
| dicrotophos (CHEBI:38658) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| dicrotophos (CHEBI:38658) is a dialkyl phosphate (CHEBI:16648) |
| dicrotophos (CHEBI:38658) is a organophosphate insecticide (CHEBI:25708) |
| IUPAC Name |
|---|
| (1E)-3-(dimethylamino)-1-methyl-3-oxoprop-1-en-1-yl dimethyl phosphate |
| Synonyms | Source |
|---|---|
| 3-Dimethoxyphosphinoyloxy-N,N-dimethylisocrotonamide | ChemIDplus |
| 3-(Dimethoxyphosphinyloxy)-N,N-dimethyl-cis-crotonamide | ChemIDplus |
| Bidrin | ChemIDplus |
| Dimethyl (E)-2-dimethyl-carbamoyl-1-methylvinyl phosphate | ChemIDplus |
| (E)-2-Dimethylcarbamoyl-1-methylvinyl dimethyl phosphate | ChemIDplus |
| (E)-Phosphoric acid, 3-(dimethylamino)-1-methyl-3-oxo-1-propenyl dimethyl ester | ChemIDplus |