EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12O2 |
| Net Charge | 0 |
| Average Mass | 116.160 |
| Monoisotopic Mass | 116.08373 |
| SMILES | CC(C)[C@@H](C)C(=O)O |
| InChI | InChI=1S/C6H12O2/c1-4(2)5(3)6(7)8/h4-5H,1-3H3,(H,7,8)/t5-/m1/s1 |
| InChIKey | XFOASZQZPWEJAA-RXMQYKEDSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-2,3-dimethylbutyric acid (CHEBI:38651) is a 2,3-dimethylbutyric acid (CHEBI:38650) |
| (R)-2,3-dimethylbutyric acid (CHEBI:38651) is enantiomer of (S)-2,3-dimethylbutyric acid (CHEBI:38652) |
| Incoming Relation(s) |
| (S)-2,3-dimethylbutyric acid (CHEBI:38652) is enantiomer of (R)-2,3-dimethylbutyric acid (CHEBI:38651) |
| IUPAC Name |
|---|
| (2R)-2,3-dimethylbutanoic acid |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1720651 | Beilstein |