EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H30O4 |
| Net Charge | 0 |
| Average Mass | 370.489 |
| Monoisotopic Mass | 370.21441 |
| SMILES | Cc1cc(C)c(C2=C(OC(=O)CC(C)(C)C)C3(CCCC3)OC2=O)c(C)c1 |
| InChI | InChI=1S/C23H30O4/c1-14-11-15(2)18(16(3)12-14)19-20(26-17(24)13-22(4,5)6)23(27-21(19)25)9-7-8-10-23/h11-12H,7-10,13H2,1-6H3 |
| InChIKey | GOLXNESZZPUPJE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| spiromesifen (CHEBI:38640) has functional parent 1,3,5-trimethylbenzene (CHEBI:34833) |
| spiromesifen (CHEBI:38640) has functional parent 3,3-dimethylbutyric acid (CHEBI:38647) |
| spiromesifen (CHEBI:38640) has role insecticide (CHEBI:24852) |
| spiromesifen (CHEBI:38640) is a butenolide (CHEBI:50523) |
| IUPAC Name |
|---|
| 2-oxo-3-(2,4,6-trimethylphenyl)-1-oxaspiro[4.4]non-3-en-4-yl 3,3-dimethylbutanoate |
| Synonyms | Source |
|---|---|
| spiromesifen | ChemIDplus |
| 3-mesityl-2-oxo-1-oxaspiro[4.4]non-3-en-4-yl 3,3-dimethylbutanoate | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| C18488 | KEGG COMPOUND |
| CN101578990 | Patent |
| US2009156669 | Patent |
| CN101584318 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9659908 | Reaxys |
| CAS:283594-90-1 | ChemIDplus |
| CAS:283594-90-1 | KEGG COMPOUND |
| Citations |
|---|