EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H24Cl2O4 |
| Net Charge | 0 |
| Average Mass | 411.325 |
| Monoisotopic Mass | 410.10516 |
| SMILES | CCC(C)(C)C(=O)OC1=C(c2ccc(Cl)cc2Cl)C(=O)OC12CCCCC2 |
| InChI | InChI=1S/C21H24Cl2O4/c1-4-20(2,3)19(25)26-17-16(14-9-8-13(22)12-15(14)23)18(24)27-21(17)10-6-5-7-11-21/h8-9,12H,4-7,10-11H2,1-3H3 |
| InChIKey | DTDSAWVUFPGDMX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| spirodiclofen (CHEBI:38639) has functional parent 1,3-dichlorobenzene (CHEBI:36693) |
| spirodiclofen (CHEBI:38639) is a dichlorobenzene (CHEBI:23697) |
| spirodiclofen (CHEBI:38639) is a organochlorine acaricide (CHEBI:38657) |
| spirodiclofen (CHEBI:38639) is a oxaspiro compound (CHEBI:37948) |
| spirodiclofen (CHEBI:38639) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| 3-(2,4-dichlorophenyl)-2-oxo-1-oxaspiro[4.5]dec-3-en-4-yl 2,2-dimethylbutanoate |
| Synonym | Source |
|---|---|
| spirodiclofen | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:9660994 | Beilstein |
| CAS:148477-71-8 | ChemIDplus |
| CAS:148477-71-8 | KEGG COMPOUND |