EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:38628 - tolfenpyrad
| Formula | C21H22ClN3O2 |
| Net Charge | 0 |
| Average Mass | 383.879 |
| Monoisotopic Mass | 383.14005 |
| SMILES | CCc1nn(C)c(C(=O)NCc2ccc(Oc3ccc(C)cc3)cc2)c1Cl |
| InChI | InChI=1S/C21H22ClN3O2/c1-4-18-19(22)20(25(3)24-18)21(26)23-13-15-7-11-17(12-8-15)27-16-9-5-14(2)6-10-16/h5-12H,4,13H2,1-3H3,(H,23,26) |
| InChIKey | WPALTCMYPARVNV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 1.3.5.1 [succinate dehydrogenase (quinone)] inhibitor An EC 1.3.5.* (oxidoreductase acting on CH-CH of donor with a quinone or related compound as acceptor) inhibitor that interferes with the action of succinate dehydrogenase (quinone), EC 1.3.5.1. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tolfenpyrad (CHEBI:38628) has role agrochemical (CHEBI:33286) |
| tolfenpyrad (CHEBI:38628) has role antifungal agent (CHEBI:35718) |
| tolfenpyrad (CHEBI:38628) has role EC 1.3.5.1 [succinate dehydrogenase (quinone)] inhibitor (CHEBI:83072) |
| tolfenpyrad (CHEBI:38628) has role mitochondrial NADH:ubiquinone reductase inhibitor (CHEBI:38498) |
| tolfenpyrad (CHEBI:38628) is a aromatic amide (CHEBI:62733) |
| tolfenpyrad (CHEBI:38628) is a aromatic ether (CHEBI:35618) |
| tolfenpyrad (CHEBI:38628) is a organochlorine compound (CHEBI:36683) |
| tolfenpyrad (CHEBI:38628) is a pyrazole insecticide (CHEBI:26409) |
| IUPAC Name |
|---|
| 4-chloro-3-ethyl-1-methyl-N-[4-(4-methylphenoxy)benzyl]-1H-pyrazole-5-carboxamide |
| Synonyms | Source |
|---|---|
| 4-chloro-3-ethyl-1-methyl-N-(4-(p-tolyloxy)benzyl)pyrazole-5-carboxamide | ChemIDplus |
| tolfenpyrad | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1687 | PPDB |
| C18491 | KEGG COMPOUND |
| CN101617680 | Patent |
| CN101653123 | Patent |
| CN101653124 | Patent |
| CN101658178 | Patent |
| CN101669476 | Patent |
| CN101669478 | Patent |
| CN101669500 | Patent |
| tolfenpyrad | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:13666608 | Reaxys |
| CAS:129558-76-5 | ChemIDplus |
| CAS:129558-76-5 | KEGG COMPOUND |
| CAS:129558-76-5 | NIST Chemistry WebBook |
| Citations |
|---|