EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H22ClN3O2 |
| Net Charge | 0 |
| Average Mass | 383.879 |
| Monoisotopic Mass | 383.14005 |
| SMILES | CCc1nn(C)c(C(=O)NCc2ccc(Oc3ccc(C)cc3)cc2)c1Cl |
| InChI | InChI=1S/C21H22ClN3O2/c1-4-18-19(22)20(25(3)24-18)21(26)23-13-15-7-11-17(12-8-15)27-16-9-5-14(2)6-10-16/h5-12H,4,13H2,1-3H3,(H,23,26) |
| InChIKey | WPALTCMYPARVNV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. EC 1.3.5.1 [succinate dehydrogenase (quinone)] inhibitor An EC 1.3.5.* (oxidoreductase acting on CH-CH of donor with a quinone or related compound as acceptor) inhibitor that interferes with the action of succinate dehydrogenase (quinone), EC 1.3.5.1. |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tolfenpyrad (CHEBI:38628) has role agrochemical (CHEBI:33286) |
| tolfenpyrad (CHEBI:38628) has role antifungal agent (CHEBI:35718) |
| tolfenpyrad (CHEBI:38628) has role EC 1.3.5.1 [succinate dehydrogenase (quinone)] inhibitor (CHEBI:83072) |
| tolfenpyrad (CHEBI:38628) has role mitochondrial NADH:ubiquinone reductase inhibitor (CHEBI:38498) |
| tolfenpyrad (CHEBI:38628) is a aromatic amide (CHEBI:62733) |
| tolfenpyrad (CHEBI:38628) is a aromatic ether (CHEBI:35618) |
| tolfenpyrad (CHEBI:38628) is a organochlorine compound (CHEBI:36683) |
| tolfenpyrad (CHEBI:38628) is a pyrazole insecticide (CHEBI:26409) |
| IUPAC Name |
|---|
| 4-chloro-3-ethyl-1-methyl-N-[4-(4-methylphenoxy)benzyl]-1H-pyrazole-5-carboxamide |
| Synonyms | Source |
|---|---|
| 4-chloro-3-ethyl-1-methyl-N-(4-(p-tolyloxy)benzyl)pyrazole-5-carboxamide | ChemIDplus |
| tolfenpyrad | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1687 | PPDB |
| C18491 | KEGG COMPOUND |
| CN101617680 | Patent |
| CN101653123 | Patent |
| CN101653124 | Patent |
| CN101658178 | Patent |
| CN101669476 | Patent |
| CN101669478 | Patent |
| CN101669500 | Patent |
| tolfenpyrad | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:13666608 | Reaxys |
| CAS:129558-76-5 | ChemIDplus |
| CAS:129558-76-5 | KEGG COMPOUND |
| CAS:129558-76-5 | NIST Chemistry WebBook |
| Citations |
|---|